![]() |
Name |
Pseurotin A2
|
Molecular Formula | C22H25NO8 | |
IUPAC Name* |
(5S,8R,9S)-8-benzoyl-2-[(Z,1S,2S)-1,2-dihydroxyhex-3-enyl]-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione
|
|
SMILES |
CC/C=C\[C@@H]([C@@H](C1=C(C(=O)[C@@]2(O1)[C@@H]([C@](NC2=O)(C(=O)C3=CC=CC=C3)OC)O)C)O)O
|
|
InChI |
InChI=1S/C22H25NO8/c1-4-5-11-14(24)15(25)16-12(2)17(26)21(31-16)19(28)22(30-3,23-20(21)29)18(27)13-9-7-6-8-10-13/h5-11,14-15,19,24-25,28H,4H2,1-3H3,(H,23,29)/b11-5-/t14-,15-,19-,21+,22-/m0/s1
|
|
InChIKey |
SLYDIPAXCVVRNY-OZPDKZFZSA-N
|
|
Synonyms |
Pseurotin A2; CHEMBL4066139
|
|
CAS | NA | |
PubChem CID | 51002918 | |
ChEMBL ID | CHEMBL4066139 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 431.4 | ALogp: | 0.5 |
HBD: | 4 | HBA: | 8 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 142.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 31 | QED Weighted: | 0.276 |
Caco-2 Permeability: | -5.003 | MDCK Permeability: | 0.00003510 |
Pgp-inhibitor: | 0.826 | Pgp-substrate: | 0.05 |
Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.023 |
30% Bioavailability (F30%): | 0.777 |
Blood-Brain-Barrier Penetration (BBB): | 0.79 | Plasma Protein Binding (PPB): | 77.84% |
Volume Distribution (VD): | 0.743 | Fu: | 15.11% |
CYP1A2-inhibitor: | 0.022 | CYP1A2-substrate: | 0.628 |
CYP2C19-inhibitor: | 0.032 | CYP2C19-substrate: | 0.669 |
CYP2C9-inhibitor: | 0.021 | CYP2C9-substrate: | 0.026 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.086 |
CYP3A4-inhibitor: | 0.041 | CYP3A4-substrate: | 0.465 |
Clearance (CL): | 7.411 | Half-life (T1/2): | 0.246 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.123 |
Drug-inuced Liver Injury (DILI): | 0.971 | AMES Toxicity: | 0.206 |
Rat Oral Acute Toxicity: | 0.362 | Maximum Recommended Daily Dose: | 0.013 |
Skin Sensitization: | 0.662 | Carcinogencity: | 0.214 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.315 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003742 | ![]() |
1.000 | D08UMH | ![]() |
0.279 | ||
ENC003765 | ![]() |
1.000 | D0Y7RW | ![]() |
0.272 | ||
ENC002116 | ![]() |
0.670 | D07RGW | ![]() |
0.267 | ||
ENC002999 | ![]() |
0.590 | D0B7OD | ![]() |
0.263 | ||
ENC003736 | ![]() |
0.477 | D0E3WQ | ![]() |
0.256 | ||
ENC002521 | ![]() |
0.323 | D0U5RT | ![]() |
0.252 | ||
ENC000888 | ![]() |
0.297 | D0Z9NZ | ![]() |
0.252 | ||
ENC001726 | ![]() |
0.296 | D0E9WO | ![]() |
0.252 | ||
ENC003270 | ![]() |
0.287 | D0WV4M | ![]() |
0.250 | ||
ENC003889 | ![]() |
0.285 | D0QQ6Q | ![]() |
0.248 |