![]() |
Name |
chaetocochin C
|
Molecular Formula | C33H36N6O6S4 | |
IUPAC Name* |
(1S,3S,11R,14S)-14-(hydroxymethyl)-3-[3-[[(2S,5S)-5-(hydroxymethyl)-1,4-dimethyl-2,5-bis(methylsulfanyl)-3,6-dioxopiperazin-2-yl]methyl]indol-1-yl]-18-methyl-15,16-dithia-10,12,18-triazapentacyclo[12.2.2.01,12.03,11.04,9]octadeca-4,6,8-triene-13,17-dione
|
|
SMILES |
CN1C(=O)[C@](N(C(=O)[C@]1(CC2=CN(C3=CC=CC=C32)[C@]45C[C@]67C(=O)N([C@](C(=O)N6[C@H]4NC8=CC=CC=C58)(SS7)CO)C)SC)C)(CO)SC
|
|
InChI |
InChI=1S/C33H36N6O6S4/c1-35-27(44)32(17-40,47-5)36(2)25(42)30(35,46-4)14-19-15-38(23-13-9-6-10-20(19)23)29-16-31-26(43)37(3)33(18-41,49-48-31)28(45)39(31)24(29)34-22-12-8-7-11-21(22)29/h6-13,15,24,34,40-41H,14,16-18H2,1-5H3/t24-,29+,30+,31+,32+,33+/m1/s1
|
|
InChIKey |
DNXUJPNYOCDWFN-ZIBPZDQUSA-N
|
|
Synonyms |
chaetocochin C; CHEMBL504373; 912551-39-4
|
|
CAS | NA | |
PubChem CID | 44559109 | |
ChEMBL ID | CHEMBL504373 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 740.9 | ALogp: | 2.7 |
HBD: | 3 | HBA: | 11 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 240.0 | Aromatic Rings: | 9 |
Heavy Atoms: | 49 | QED Weighted: | 0.309 |
Caco-2 Permeability: | -5.642 | MDCK Permeability: | 0.00001090 |
Pgp-inhibitor: | 0.595 | Pgp-substrate: | 0.098 |
Human Intestinal Absorption (HIA): | 0.5 | 20% Bioavailability (F20%): | 0.097 |
30% Bioavailability (F30%): | 0.912 |
Blood-Brain-Barrier Penetration (BBB): | 0.089 | Plasma Protein Binding (PPB): | 93.19% |
Volume Distribution (VD): | 1.655 | Fu: | 1.79% |
CYP1A2-inhibitor: | 0.019 | CYP1A2-substrate: | 0.452 |
CYP2C19-inhibitor: | 0.972 | CYP2C19-substrate: | 0.971 |
CYP2C9-inhibitor: | 0.98 | CYP2C9-substrate: | 0.14 |
CYP2D6-inhibitor: | 0.05 | CYP2D6-substrate: | 0.022 |
CYP3A4-inhibitor: | 0.975 | CYP3A4-substrate: | 0.994 |
Clearance (CL): | 8.294 | Half-life (T1/2): | 0.004 |
hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.483 |
Drug-inuced Liver Injury (DILI): | 0.991 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.876 | Maximum Recommended Daily Dose: | 0.023 |
Skin Sensitization: | 0.835 | Carcinogencity: | 0.538 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
Respiratory Toxicity: | 0 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004867 | ![]() |
0.769 | D0V9WF | ![]() |
0.262 | ||
ENC002348 | ![]() |
0.769 | D02TJS | ![]() |
0.225 | ||
ENC003455 | ![]() |
0.763 | D0SP3D | ![]() |
0.223 | ||
ENC003978 | ![]() |
0.627 | D01TSI | ![]() |
0.222 | ||
ENC002354 | ![]() |
0.497 | D0J5YC | ![]() |
0.219 | ||
ENC001500 | ![]() |
0.436 | D07VHR | ![]() |
0.217 | ||
ENC004848 | ![]() |
0.432 | D09NNH | ![]() |
0.217 | ||
ENC003530 | ![]() |
0.424 | D0V3ZA | ![]() |
0.216 | ||
ENC003382 | ![]() |
0.420 | D07NVU | ![]() |
0.215 | ||
ENC004849 | ![]() |
0.409 | D0U8UV | ![]() |
0.213 |