![]() |
Name |
L-gamma-glutamyl phosphate(2-)
|
Molecular Formula | C5H8NO7P-2 | |
IUPAC Name* |
(2S)-2-azaniumyl-5-oxo-5-phosphonatooxypentanoate
|
|
SMILES |
C(CC(=O)OP(=O)([O-])[O-])[C@@H](C(=O)[O-])[NH3+]
|
|
InChI |
InChI=1S/C5H10NO7P/c6-3(5(8)9)1-2-4(7)13-14(10,11)12/h3H,1-2,6H2,(H,8,9)(H2,10,11,12)/p-2/t3-/m0/s1
|
|
InChIKey |
PJRXVIJAERNUIP-VKHMYHEASA-L
|
|
Synonyms |
L-gamma-glutamyl phosphate(2-); gamma-L-glutamyl-5-P; gamma-L-glutamyl 5-phosphate; CHEBI:58274; L-gamma-glutamyl phosphate dianion; (2S)-2-ammonio-5-oxo-5-(phosphonatooxy)pentanoate; (2S)-2-azaniumyl-5-oxo-5-(phosphonatooxy)pentanoate; Q27125662
|
|
CAS | NA | |
PubChem CID | 44457531 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 225.09 | ALogp: | -4.3 |
HBD: | 1 | HBA: | 7 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 157.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 14 | QED Weighted: | 0.438 |
Caco-2 Permeability: | -6.116 | MDCK Permeability: | 0.00369561 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.081 |
Human Intestinal Absorption (HIA): | 0.838 | 20% Bioavailability (F20%): | 0.092 |
30% Bioavailability (F30%): | 0.799 |
Blood-Brain-Barrier Penetration (BBB): | 0.743 | Plasma Protein Binding (PPB): | 12.49% |
Volume Distribution (VD): | 0.297 | Fu: | 84.35% |
CYP1A2-inhibitor: | 0.001 | CYP1A2-substrate: | 0.018 |
CYP2C19-inhibitor: | 0.047 | CYP2C19-substrate: | 0.033 |
CYP2C9-inhibitor: | 0.026 | CYP2C9-substrate: | 0.689 |
CYP2D6-inhibitor: | 0.089 | CYP2D6-substrate: | 0.11 |
CYP3A4-inhibitor: | 0.01 | CYP3A4-substrate: | 0.004 |
Clearance (CL): | 2.286 | Half-life (T1/2): | 0.798 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.066 |
Drug-inuced Liver Injury (DILI): | 0.026 | AMES Toxicity: | 0.034 |
Rat Oral Acute Toxicity: | 0.002 | Maximum Recommended Daily Dose: | 0.24 |
Skin Sensitization: | 0.435 | Carcinogencity: | 0.023 |
Eye Corrosion: | 0.013 | Eye Irritation: | 0.116 |
Respiratory Toxicity: | 0.269 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001759 | ![]() |
0.409 | D0OT0O | ![]() |
0.293 | ||
ENC002557 | ![]() |
0.296 | D03RCJ | ![]() |
0.267 | ||
ENC001760 | ![]() |
0.239 | D01EKQ | ![]() |
0.236 | ||
ENC000735 | ![]() |
0.234 | D04CJL | ![]() |
0.236 | ||
ENC000234 | ![]() |
0.220 | D0QC5D | ![]() |
0.236 | ||
ENC001900 | ![]() |
0.220 | D07QPM | ![]() |
0.228 | ||
ENC000795 | ![]() |
0.212 | D0Q4EW | ![]() |
0.228 | ||
ENC001253 | ![]() |
0.208 | D00ENY | ![]() |
0.224 | ||
ENC001036 | ![]() |
0.208 | D01JIA | ![]() |
0.224 | ||
ENC000758 | ![]() |
0.208 | D0OL6O | ![]() |
0.220 |