![]() |
Name |
Dehydroergosterol 3,5-dinitrobenzoate
|
Molecular Formula | C35H44N2O6 | |
IUPAC Name* |
[(3S,10S,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-dinitrobenzoate
|
|
SMILES |
C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC=C3C2=CC=C4[C@@]3(CC[C@@H](C4)OC(=O)C5=CC(=CC(=C5)[N+](=O)[O-])[N+](=O)[O-])C)C
|
|
InChI |
InChI=1S/C35H44N2O6/c1-21(2)22(3)7-8-23(4)30-11-12-31-29-10-9-25-19-28(13-15-34(25,5)32(29)14-16-35(30,31)6)43-33(38)24-17-26(36(39)40)20-27(18-24)37(41)42/h7-10,14,17-18,20-23,28,30-31H,11-13,15-16,19H2,1-6H3/b8-7+/t22-,23+,28-,30+,31-,34-,35+/m0/s1
|
|
InChIKey |
NLLQYDBMCPAJHT-IZFBALMBSA-N
|
|
Synonyms |
Dehydroergosterol 3,5-dinitrobenzoate; Dehydroergosteryl 3,5-dinitrobenzoate; 9(11)-Dehydroergosterol 3,5-dinitrobenzoate; 9(11)-Dehydroergosteryl 3,5-dinitrobenzoate; (22E)-Ergosta-5,7,9(11),22-tetraen-3-yl 3,5-dinitrobenzoate #
|
|
CAS | NA | |
PubChem CID | 21159991 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 588.7 | ALogp: | 8.8 |
HBD: | 0 | HBA: | 6 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 118.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 43 | QED Weighted: | 0.115 |
Caco-2 Permeability: | -4.845 | MDCK Permeability: | 0.00011425 |
Pgp-inhibitor: | 1 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.999 |
30% Bioavailability (F30%): | 0.597 |
Blood-Brain-Barrier Penetration (BBB): | 0.009 | Plasma Protein Binding (PPB): | 100.68% |
Volume Distribution (VD): | 1.821 | Fu: | 2.10% |
CYP1A2-inhibitor: | 0.132 | CYP1A2-substrate: | 0.38 |
CYP2C19-inhibitor: | 0.897 | CYP2C19-substrate: | 0.613 |
CYP2C9-inhibitor: | 0.782 | CYP2C9-substrate: | 0.121 |
CYP2D6-inhibitor: | 0.79 | CYP2D6-substrate: | 0.128 |
CYP3A4-inhibitor: | 0.86 | CYP3A4-substrate: | 0.855 |
Clearance (CL): | 0.734 | Half-life (T1/2): | 0.064 |
hERG Blockers: | 0.183 | Human Hepatotoxicity (H-HT): | 0.676 |
Drug-inuced Liver Injury (DILI): | 0.167 | AMES Toxicity: | 0.838 |
Rat Oral Acute Toxicity: | 0.958 | Maximum Recommended Daily Dose: | 0.963 |
Skin Sensitization: | 0.712 | Carcinogencity: | 0.096 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.014 |
Respiratory Toxicity: | 0.919 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001721 | ![]() |
0.695 | D0G8OC | ![]() |
0.329 | ||
ENC004739 | ![]() |
0.435 | D06JPB | ![]() |
0.329 | ||
ENC006033 | ![]() |
0.408 | D0G5CF | ![]() |
0.316 | ||
ENC001092 | ![]() |
0.404 | D06CNP | ![]() |
0.256 | ||
ENC005258 | ![]() |
0.404 | D0N1TP | ![]() |
0.242 | ||
ENC005707 | ![]() |
0.404 | D0Y7LD | ![]() |
0.233 | ||
ENC004738 | ![]() |
0.404 | D0FW2A | ![]() |
0.226 | ||
ENC002665 | ![]() |
0.394 | D01QUS | ![]() |
0.226 | ||
ENC006032 | ![]() |
0.388 | D08SVH | ![]() |
0.220 | ||
ENC003678 | ![]() |
0.385 | D0K5WS | ![]() |
0.217 |