![]() |
Name |
steroids ergosterol
|
Molecular Formula | C29H46 | |
IUPAC Name* |
17-(5,6-dimethylhept-3-en-2-yl)-3,10,13-trimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene
|
|
SMILES |
CC1CCC2(C)C(=CC=C3C2CCC2(C)C3CCC2C(C)C=CC(C)C(C)C)C1
|
|
InChI |
InChI=1S/C29H46/c1-19(2)21(4)8-9-22(5)25-12-13-26-24-11-10-23-18-20(3)14-16-28(23,6)27(24)15-17-29(25,26)7/h8-11,19-22,25-27H,12-18H2,1-7H3/b9-8+/t20-,21?,22+,25+,26?,27?,28-,29+/m0/s1
|
|
InChIKey |
RWSNIMCJNVEZHV-WPWBJWPESA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 394.69 | ALogp: | 8.6 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 0.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 29 | QED Weighted: | 0.382 |
Caco-2 Permeability: | -4.871 | MDCK Permeability: | 0.00000453 |
Pgp-inhibitor: | 0.984 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.007 |
30% Bioavailability (F30%): | 0.671 |
Blood-Brain-Barrier Penetration (BBB): | 0.197 | Plasma Protein Binding (PPB): | 100.80% |
Volume Distribution (VD): | 3.482 | Fu: | 1.52% |
CYP1A2-inhibitor: | 0.057 | CYP1A2-substrate: | 0.475 |
CYP2C19-inhibitor: | 0.135 | CYP2C19-substrate: | 0.979 |
CYP2C9-inhibitor: | 0.096 | CYP2C9-substrate: | 0.117 |
CYP2D6-inhibitor: | 0.041 | CYP2D6-substrate: | 0.244 |
CYP3A4-inhibitor: | 0.232 | CYP3A4-substrate: | 0.911 |
Clearance (CL): | 13.187 | Half-life (T1/2): | 0.013 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.01 |
Drug-inuced Liver Injury (DILI): | 0.042 | AMES Toxicity: | 0.043 |
Rat Oral Acute Toxicity: | 0.448 | Maximum Recommended Daily Dose: | 0.589 |
Skin Sensitization: | 0.099 | Carcinogencity: | 0.044 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.019 |
Respiratory Toxicity: | 0.773 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005707 | ![]() |
0.860 | D0G8OC | ![]() |
0.509 | ||
ENC001092 | ![]() |
0.860 | D06JPB | ![]() |
0.455 | ||
ENC004738 | ![]() |
0.860 | D0G5CF | ![]() |
0.446 | ||
ENC005238 | ![]() |
0.734 | D0Y7LD | ![]() |
0.370 | ||
ENC005270 | ![]() |
0.688 | D0N1TP | ![]() |
0.350 | ||
ENC002665 | ![]() |
0.667 | D01QUS | ![]() |
0.325 | ||
ENC002892 | ![]() |
0.660 | D08SVH | ![]() |
0.306 | ||
ENC004803 | ![]() |
0.638 | D0K5WS | ![]() |
0.295 | ||
ENC004735 | ![]() |
0.600 | D0B4RU | ![]() |
0.286 | ||
ENC004906 | ![]() |
0.587 | D06XMU | ![]() |
0.275 |