![]() |
Name |
Terretonin
|
Molecular Formula | C26H32O9 | |
IUPAC Name* |
methyl (2R,4aR,4bS,10aS,10bS,12aR)-6,10b-dihydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-4a,9,10,11-tetrahydronaphtho[1,2-h]isochromene-2-carboxylate
|
|
SMILES |
C[C@]12CCC(=O)C(C1=C(C(=O)[C@@]3([C@@]2(CC(=C)[C@]4([C@H]3C(=O)O[C@@](C4=O)(C)C(=O)OC)C)O)C)O)(C)C
|
|
InChI |
InChI=1S/C26H32O9/c1-12-11-26(33)22(4)10-9-13(27)21(2,3)15(22)14(28)17(29)24(26,6)16-18(30)35-25(7,20(32)34-8)19(31)23(12,16)5/h16,28,33H,1,9-11H2,2-8H3/t16-,22+,23+,24-,25-,26+/m1/s1
|
|
InChIKey |
CYHGEJACRPDZDP-IKNWHQMFSA-N
|
|
Synonyms |
Terretonin; MLS000876995; methyl (2R,4aR,4bS,10aS,10bS,12aR)-6,10b-dihydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4,5,8-tetraoxo-4a,9,10,11-tetrahydronaphtho[1,2-h]isochromene-2-carboxylate; 71911-90-5; CHEMBL511953; MEGxm0_000071; ACon0_000840; ACon1_000512; HMS2270I22; BDBM50478874; NCGC00169009-01; NCGC00169009-02; SMR000440631
|
|
CAS | NA | |
PubChem CID | 16196970 | |
ChEMBL ID | CHEMBL511953 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 488.5 | ALogp: | 1.2 |
HBD: | 2 | HBA: | 9 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 144.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 35 | QED Weighted: | 0.323 |
Caco-2 Permeability: | -5.416 | MDCK Permeability: | 0.00005320 |
Pgp-inhibitor: | 0.483 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.117 | 20% Bioavailability (F20%): | 0.956 |
30% Bioavailability (F30%): | 0.861 |
Blood-Brain-Barrier Penetration (BBB): | 0.96 | Plasma Protein Binding (PPB): | 63.70% |
Volume Distribution (VD): | 0.388 | Fu: | 40.51% |
CYP1A2-inhibitor: | 0.002 | CYP1A2-substrate: | 0.987 |
CYP2C19-inhibitor: | 0.032 | CYP2C19-substrate: | 0.824 |
CYP2C9-inhibitor: | 0.042 | CYP2C9-substrate: | 0.025 |
CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.042 |
CYP3A4-inhibitor: | 0.746 | CYP3A4-substrate: | 0.918 |
Clearance (CL): | 2.921 | Half-life (T1/2): | 0.139 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.126 |
Drug-inuced Liver Injury (DILI): | 0.876 | AMES Toxicity: | 0.118 |
Rat Oral Acute Toxicity: | 0.037 | Maximum Recommended Daily Dose: | 0.031 |
Skin Sensitization: | 0.37 | Carcinogencity: | 0.301 |
Eye Corrosion: | 0.144 | Eye Irritation: | 0.09 |
Respiratory Toxicity: | 0.942 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003284 | ![]() |
1.000 | D0H2MO | ![]() |
0.250 | ||
ENC002162 | ![]() |
0.712 | D0Q4SD | ![]() |
0.225 | ||
ENC006004 | ![]() |
0.496 | D06IIB | ![]() |
0.208 | ||
ENC003850 | ![]() |
0.422 | D0X4RS | ![]() |
0.207 | ||
ENC003376 | ![]() |
0.386 | D0KR9U | ![]() |
0.205 | ||
ENC005629 | ![]() |
0.366 | D0IL7L | ![]() |
0.201 | ||
ENC002033 | ![]() |
0.357 | D0IX6I | ![]() |
0.201 | ||
ENC005188 | ![]() |
0.338 | D0I5DS | ![]() |
0.199 | ||
ENC005317 | ![]() |
0.323 | D0WY9N | ![]() |
0.195 | ||
ENC005189 | ![]() |
0.323 | D0L2LS | ![]() |
0.192 |