![]() |
Name |
Pyripyropene A
|
Molecular Formula | C31H37NO10 | |
IUPAC Name* |
[(1S,2S,5S,6R,7R,9S,10S,18R)-5,9-diacetyloxy-18-hydroxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl acetate
|
|
SMILES |
CC(=O)OC[C@@]1([C@H](CC[C@]2([C@H]1C[C@@H]([C@@]3([C@@H]2[C@H](C4=C(O3)C=C(OC4=O)C5=CN=CC=C5)O)C)OC(=O)C)C)OC(=O)C)C
|
|
InChI |
InChI=1S/C31H37NO10/c1-16(33)38-15-30(5)22-13-24(40-18(3)35)31(6)27(29(22,4)10-9-23(30)39-17(2)34)26(36)25-21(42-31)12-20(41-28(25)37)19-8-7-11-32-14-19/h7-8,11-12,14,22-24,26-27,36H,9-10,13,15H2,1-6H3/t22-,23+,24+,26+,27-,29+,30+,31-/m1/s1
|
|
InChIKey |
PMMQOFWSZRQWEV-RVTXXDJVSA-N
|
|
Synonyms |
Pyripyropene A; 147444-03-9; (3S,4R,4aR,6S,6aS,12R,12aS,12bS)-4-(acetoxymethyl)-12-hydroxy-4,6a,12b-trimethyl-11-oxo-9-(pyridin-3-yl)-1,3,4,4a,5,6,6a,12,12a,12b-decahydro-2H,11H-benzo[f]pyrano[4,3-b]chromene-3,6-diyl diacetate; [(1S,2S,5S,6R,7R,9S,10S,18R)-5,9-diacetyloxy-18-hydroxy-2,6,10-trimethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-6-yl]methyl acetate; (3S,4R,4aR,6S,6aS,12R,12aS,12bS)-4-(Acetoxymethyl)-12-hydroxy-4,6a,12b-trimethyl-11-oxo-9-(pyridin-3-yl)-1,2,3,4,4a,5,6,6a,11,12,12a,12b-dodecahydrobenzo[f]pyrano[4,3-b]chromene-3,6-diyl diacetate; (3S,4R,4aR,6S,6aS,12R,12aS,12bS)-4-[(acetyloxy)methyl]-12-hydroxy-4,6a,12b-trimethyl-11-oxo-9-(pyridin-3-yl)-1,3,4,4a,5,6,6a,12,12a,12b-decahydro-2H,11H-naphtho[2,1-b]pyrano[3,4-e]pyran-3,6-diyl diacetate; SCHEMBL106356; MEGxm0_000331; CHEMBL4518651; ACon0_000398; ACon1_001711; CHEBI:64695; DTXSID601017602; FO 1289A; ZINC3945398; NCGC00180218-01; NCGC00180218-02!; HY-117832; CS-0068214; Q27133384; 2H,11H-Naphtho(2,1-b)pyrano(3,4-e)pyran-11-one, 1,3,4,4a,5,6a,12,12a,12b-decahydro-4-((acetyloxy)methyl)-3,6-bis(acetyloxy)-12-hydroxy-9-(3-pyridinyl)-4,6a,12b-trimethyl-; 7T8
|
|
CAS | 147444-03-9 | |
PubChem CID | 11828024 | |
ChEMBL ID | CHEMBL4518651 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 583.6 | ALogp: | 2.5 |
HBD: | 1 | HBA: | 11 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 148.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 42 | QED Weighted: | 0.393 |
Caco-2 Permeability: | -4.911 | MDCK Permeability: | 0.00006570 |
Pgp-inhibitor: | 0.996 | Pgp-substrate: | 0.058 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.062 |
30% Bioavailability (F30%): | 0.992 |
Blood-Brain-Barrier Penetration (BBB): | 0.779 | Plasma Protein Binding (PPB): | 42.97% |
Volume Distribution (VD): | 1.21 | Fu: | 31.20% |
CYP1A2-inhibitor: | 0.034 | CYP1A2-substrate: | 0.068 |
CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.175 |
CYP2C9-inhibitor: | 0.041 | CYP2C9-substrate: | 0.055 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.082 |
CYP3A4-inhibitor: | 0.671 | CYP3A4-substrate: | 0.418 |
Clearance (CL): | 1.898 | Half-life (T1/2): | 0.187 |
hERG Blockers: | 0.355 | Human Hepatotoxicity (H-HT): | 0.932 |
Drug-inuced Liver Injury (DILI): | 0.897 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.129 | Maximum Recommended Daily Dose: | 0.437 |
Skin Sensitization: | 0.277 | Carcinogencity: | 0.061 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.012 |
Respiratory Toxicity: | 0.754 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002044 | ![]() |
0.627 | D06CNP | ![]() |
0.286 | ||
ENC005020 | ![]() |
0.500 | D0G7KJ | ![]() |
0.284 | ||
ENC002192 | ![]() |
0.458 | D08BDT | ![]() |
0.284 | ||
ENC003422 | ![]() |
0.392 | D09SIK | ![]() |
0.276 | ||
ENC002080 | ![]() |
0.377 | D0OL7F | ![]() |
0.276 | ||
ENC002410 | ![]() |
0.377 | D09WYX | ![]() |
0.269 | ||
ENC002118 | ![]() |
0.365 | D01ZOG | ![]() |
0.262 | ||
ENC003423 | ![]() |
0.365 | D03ZZK | ![]() |
0.259 | ||
ENC002411 | ![]() |
0.356 | D0X7XG | ![]() |
0.259 | ||
ENC003611 | ![]() |
0.356 | D0C4RB | ![]() |
0.254 |