|
Name |
Pyripyropene F
|
Molecular Formula | C28H35NO5 | |
IUPAC Name* |
[(1R,2S,5S,7R,10R)-2,6,6,10-tetramethyl-16-oxo-14-pyridin-3-yl-11,15-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-12(17),13-dien-5-yl] propanoate
|
|
SMILES |
CCC(=O)O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]3([C@@H]2CC4=C(O3)C=C(OC4=O)C5=CN=CC=C5)C)C
|
|
InChI |
InChI=1S/C28H35NO5/c1-6-24(30)33-23-10-11-27(4)21(26(23,2)3)9-12-28(5)22(27)14-18-20(34-28)15-19(32-25(18)31)17-8-7-13-29-16-17/h7-8,13,15-16,21-23H,6,9-12,14H2,1-5H3/t21-,22+,23-,27-,28+/m0/s1
|
|
InChIKey |
JIHRIBKMEVTBGP-ZRLOAUAMSA-N
|
|
Synonyms |
Pyripyropene F; GERI-BP-001B; 165467-56-1
|
|
CAS | NA | |
PubChem CID | 11754246 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 465.6 | ALogp: | 5.1 |
HBD: | 0 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 74.7 | Aromatic Rings: | 5 |
Heavy Atoms: | 34 | QED Weighted: | 0.537 |
Caco-2 Permeability: | -4.885 | MDCK Permeability: | 0.00002040 |
Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.019 |
30% Bioavailability (F30%): | 0.971 |
Blood-Brain-Barrier Penetration (BBB): | 0.048 | Plasma Protein Binding (PPB): | 94.43% |
Volume Distribution (VD): | 1.634 | Fu: | 6.00% |
CYP1A2-inhibitor: | 0.32 | CYP1A2-substrate: | 0.283 |
CYP2C19-inhibitor: | 0.524 | CYP2C19-substrate: | 0.632 |
CYP2C9-inhibitor: | 0.828 | CYP2C9-substrate: | 0.443 |
CYP2D6-inhibitor: | 0.039 | CYP2D6-substrate: | 0.657 |
CYP3A4-inhibitor: | 0.891 | CYP3A4-substrate: | 0.545 |
Clearance (CL): | 5.318 | Half-life (T1/2): | 0.183 |
hERG Blockers: | 0.472 | Human Hepatotoxicity (H-HT): | 0.641 |
Drug-inuced Liver Injury (DILI): | 0.637 | AMES Toxicity: | 0.003 |
Rat Oral Acute Toxicity: | 0.099 | Maximum Recommended Daily Dose: | 0.89 |
Skin Sensitization: | 0.392 | Carcinogencity: | 0.026 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.962 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005020 | 0.889 | D06CNP | 0.338 | ||||
ENC002044 | 0.737 | D02STN | 0.298 | ||||
ENC003422 | 0.582 | D09NNA | 0.295 | ||||
ENC003130 | 0.546 | D07VBA | 0.261 | ||||
ENC002118 | 0.532 | D0TB8C | 0.255 | ||||
ENC003423 | 0.508 | D0F1UL | 0.242 | ||||
ENC001980 | 0.500 | D08TEJ | 0.241 | ||||
ENC002412 | 0.459 | D0F2AK | 0.237 | ||||
ENC002198 | 0.458 | D0C7JF | 0.236 | ||||
ENC002037 | 0.442 | D02AXG | 0.235 |