|
Name |
Fumagiringillin
|
Molecular Formula | C26H36O8 | |
IUPAC Name* |
(2E,4E,6E,8E)-10-[[(3S,3aS,4S,5R,7aR)-7a-hydroxy-3-[(1R)-1-hydroxy-4-methylpent-3-enyl]-4-methoxy-3-methyl-1,3a,4,5,6,7-hexahydro-2-benzofuran-5-yl]oxy]-10-oxodeca-2,4,6,8-tetraenoic acid
|
|
SMILES |
CC(=CC[C@H]([C@@]1([C@H]2[C@@H]([C@@H](CC[C@@]2(CO1)O)OC(=O)/C=C/C=C/C=C/C=C/C(=O)O)OC)C)O)C
|
|
InChI |
InChI=1S/C26H36O8/c1-18(2)13-14-20(27)25(3)24-23(32-4)19(15-16-26(24,31)17-33-25)34-22(30)12-10-8-6-5-7-9-11-21(28)29/h5-13,19-20,23-24,27,31H,14-17H2,1-4H3,(H,28,29)/b7-5+,8-6+,11-9+,12-10+/t19-,20-,23-,24-,25-,26+/m1/s1
|
|
InChIKey |
CTJMHUNIVHCSLW-CVKHXQCASA-N
|
|
Synonyms |
Fumagiringillin; (2E,4E,6E,8E)-10-[[(3S,3aS,4S,5R,7aR)-7a-hydroxy-3-[(1R)-1-hydroxy-4-methylpent-3-enyl]-4-methoxy-3-methyl-1,3a,4,5,6,7-hexahydro-2-benzofuran-5-yl]oxy]-10-oxodeca-2,4,6,8-tetraenoic acid
|
|
CAS | NA | |
PubChem CID | 11488385 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 476.6 | ALogp: | 3.0 |
HBD: | 3 | HBA: | 8 |
Rotatable Bonds: | 11 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 123.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 34 | QED Weighted: | 0.189 |
Caco-2 Permeability: | -5.265 | MDCK Permeability: | 0.00000777 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.944 |
Human Intestinal Absorption (HIA): | 0.616 | 20% Bioavailability (F20%): | 0.046 |
30% Bioavailability (F30%): | 0.959 |
Blood-Brain-Barrier Penetration (BBB): | 0.121 | Plasma Protein Binding (PPB): | 69.04% |
Volume Distribution (VD): | 0.413 | Fu: | 9.14% |
CYP1A2-inhibitor: | 0.154 | CYP1A2-substrate: | 0.062 |
CYP2C19-inhibitor: | 0.067 | CYP2C19-substrate: | 0.05 |
CYP2C9-inhibitor: | 0.065 | CYP2C9-substrate: | 0.988 |
CYP2D6-inhibitor: | 0.703 | CYP2D6-substrate: | 0.857 |
CYP3A4-inhibitor: | 0.553 | CYP3A4-substrate: | 0.044 |
Clearance (CL): | 1.715 | Half-life (T1/2): | 0.124 |
hERG Blockers: | 0.023 | Human Hepatotoxicity (H-HT): | 0.873 |
Drug-inuced Liver Injury (DILI): | 0.588 | AMES Toxicity: | 0.011 |
Rat Oral Acute Toxicity: | 0.231 | Maximum Recommended Daily Dose: | 0.181 |
Skin Sensitization: | 0.663 | Carcinogencity: | 0.175 |
Eye Corrosion: | 0.043 | Eye Irritation: | 0.369 |
Respiratory Toxicity: | 0.958 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003807 | 0.301 | D0FG6M | 0.688 | ||||
ENC003585 | 0.301 | D0G3PI | 0.236 | ||||
ENC005222 | 0.283 | D02DGU | 0.236 | ||||
ENC001856 | 0.277 | D00DKK | 0.236 | ||||
ENC001936 | 0.274 | D0X7XG | 0.231 | ||||
ENC005164 | 0.274 | D0H2MO | 0.213 | ||||
ENC005165 | 0.274 | D0S7WX | 0.210 | ||||
ENC002137 | 0.264 | D05QDC | 0.189 | ||||
ENC003161 | 0.261 | D0Y5RZ | 0.189 | ||||
ENC002117 | 0.261 | D0Q0PR | 0.184 |