|
Name |
Lucilactaene
|
Molecular Formula | C22H27NO6 | |
IUPAC Name* |
methyl (2E,3E,5E,7E,9E)-11-[(3aS,6S,6aR)-3a-hydroxy-5-oxo-3,4,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-6-yl]-2-ethylidene-4,10-dimethyl-11-oxoundeca-3,5,7,9-tetraenoate
|
|
SMILES |
C/C=C(\C=C(/C)\C=C\C=C\C=C(/C)\C(=O)[C@@H]1[C@@H]2[C@@](CCO2)(NC1=O)O)/C(=O)OC
|
|
InChI |
InChI=1S/C22H27NO6/c1-5-16(21(26)28-4)13-14(2)9-7-6-8-10-15(3)18(24)17-19-22(27,11-12-29-19)23-20(17)25/h5-10,13,17,19,27H,11-12H2,1-4H3,(H,23,25)/b8-6+,9-7+,14-13+,15-10+,16-5+/t17-,19-,22+/m1/s1
|
|
InChIKey |
XJKYTYUOGYTPSB-HZDMFNNQSA-N
|
|
Synonyms |
Lucilactaene; CHEMBL5072627; methyl (2E,3E,5E,7E,9E)-11-[(3aS,6S,6aR)-3a-hydroxy-5-oxo-3,4,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-6-yl]-2-ethylidene-4,10-dimethyl-11-oxoundeca-3,5,7,9-tetraenoate
|
|
CAS | NA | |
PubChem CID | 9909017 | |
ChEMBL ID | CHEMBL5072627 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 401.5 | ALogp: | 2.6 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 102.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 29 | QED Weighted: | 0.294 |
Caco-2 Permeability: | -4.82 | MDCK Permeability: | 0.00001960 |
Pgp-inhibitor: | 0.996 | Pgp-substrate: | 0.006 |
Human Intestinal Absorption (HIA): | 0.392 | 20% Bioavailability (F20%): | 0.963 |
30% Bioavailability (F30%): | 0.982 |
Blood-Brain-Barrier Penetration (BBB): | 0.787 | Plasma Protein Binding (PPB): | 86.51% |
Volume Distribution (VD): | 2.253 | Fu: | 8.14% |
CYP1A2-inhibitor: | 0.07 | CYP1A2-substrate: | 0.333 |
CYP2C19-inhibitor: | 0.142 | CYP2C19-substrate: | 0.435 |
CYP2C9-inhibitor: | 0.21 | CYP2C9-substrate: | 0.063 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.179 |
CYP3A4-inhibitor: | 0.076 | CYP3A4-substrate: | 0.437 |
Clearance (CL): | 4.046 | Half-life (T1/2): | 0.834 |
hERG Blockers: | 0.49 | Human Hepatotoxicity (H-HT): | 0.575 |
Drug-inuced Liver Injury (DILI): | 0.503 | AMES Toxicity: | 0.927 |
Rat Oral Acute Toxicity: | 0.484 | Maximum Recommended Daily Dose: | 0.94 |
Skin Sensitization: | 0.951 | Carcinogencity: | 0.48 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.333 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005165 | 1.000 | D00DKK | 0.278 | ||||
ENC005164 | 1.000 | D0G3PI | 0.278 | ||||
ENC003161 | 0.569 | D02DGU | 0.278 | ||||
ENC003853 | 0.333 | D0FG6M | 0.269 | ||||
ENC003854 | 0.333 | D05QDC | 0.243 | ||||
ENC003585 | 0.314 | D0S7WX | 0.225 | ||||
ENC003807 | 0.314 | D0B1IP | 0.221 | ||||
ENC003852 | 0.290 | D0MY8N | 0.189 | ||||
ENC002157 | 0.274 | D0E9KA | 0.175 | ||||
ENC004533 | 0.256 | D0V2JK | 0.168 |