|
Name |
Agathic acid
|
Molecular Formula | C20H30O4 | |
IUPAC Name* |
(1S,4aR,5S,8aR)-5-[(E)-4-carboxy-3-methylbut-3-enyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid
|
|
SMILES |
C/C(=C\C(=O)O)/CC[C@H]1C(=C)CC[C@@H]2[C@@]1(CCC[C@]2(C)C(=O)O)C
|
|
InChI |
InChI=1S/C20H30O4/c1-13(12-17(21)22)6-8-15-14(2)7-9-16-19(15,3)10-5-11-20(16,4)18(23)24/h12,15-16H,2,5-11H2,1,3-4H3,(H,21,22)(H,23,24)/b13-12+/t15-,16+,19+,20-/m0/s1
|
|
InChIKey |
QYCOHMYDSOZCQD-GWEOMKHGSA-N
|
|
Synonyms |
Agathic acid; 640-28-8; (1S,4aR,5S,8aR)-5-[(E)-4-carboxy-3-methylbut-3-enyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid; agathicacid; Labda-8(17),13-diene-15,19-dioic acid; CHEMBL457162; Labda-8(20),13-diene-15,19-dioic acid; (1S,4abeta,5beta,8aalpha)-5-[(Z)-4-Carboxy-3-methyl-3-butenyl]decahydro-1,4a-dimethyl-6-methylene-1-naphthalenecarboxylic acid
|
|
CAS | 640-28-8 | |
PubChem CID | 6436877 | |
ChEMBL ID | CHEMBL457162 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 334.4 | ALogp: | 4.8 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 74.6 | Aromatic Rings: | 2 |
Heavy Atoms: | 24 | QED Weighted: | 0.541 |
Caco-2 Permeability: | -5.734 | MDCK Permeability: | 0.00001260 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.752 |
30% Bioavailability (F30%): | 0.013 |
Blood-Brain-Barrier Penetration (BBB): | 0.108 | Plasma Protein Binding (PPB): | 86.05% |
Volume Distribution (VD): | 0.292 | Fu: | 13.95% |
CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.126 |
CYP2C19-inhibitor: | 0.011 | CYP2C19-substrate: | 0.095 |
CYP2C9-inhibitor: | 0.024 | CYP2C9-substrate: | 0.667 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.129 |
CYP3A4-inhibitor: | 0.052 | CYP3A4-substrate: | 0.053 |
Clearance (CL): | 0.921 | Half-life (T1/2): | 0.781 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.128 |
Drug-inuced Liver Injury (DILI): | 0.131 | AMES Toxicity: | 0.011 |
Rat Oral Acute Toxicity: | 0.353 | Maximum Recommended Daily Dose: | 0.651 |
Skin Sensitization: | 0.66 | Carcinogencity: | 0.577 |
Eye Corrosion: | 0.967 | Eye Irritation: | 0.914 |
Respiratory Toxicity: | 0.957 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005986 | 0.733 | D01CKY | 0.343 | ||||
ENC003143 | 0.696 | D04VIS | 0.333 | ||||
ENC002141 | 0.513 | D0S0NK | 0.317 | ||||
ENC005547 | 0.506 | D0X7XG | 0.264 | ||||
ENC002902 | 0.506 | D00DKK | 0.255 | ||||
ENC000956 | 0.466 | D0G3PI | 0.255 | ||||
ENC005922 | 0.455 | D02DGU | 0.255 | ||||
ENC003162 | 0.424 | D02CJX | 0.252 | ||||
ENC001071 | 0.409 | D02CNR | 0.248 | ||||
ENC003214 | 0.396 | D00HWO | 0.248 |