|
Name |
Gibberellin A53
|
Molecular Formula | C20H28O5 | |
IUPAC Name* |
(1S,2S,3S,4R,8S,9S,12S)-12-hydroxy-4,8-dimethyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid
|
|
SMILES |
C[C@@]12CCC[C@@]([C@H]1[C@@H]([C@]34[C@H]2CC[C@](C3)(C(=C)C4)O)C(=O)O)(C)C(=O)O
|
|
InChI |
InChI=1S/C20H28O5/c1-11-9-19-10-20(11,25)8-5-12(19)17(2)6-4-7-18(3,16(23)24)14(17)13(19)15(21)22/h12-14,25H,1,4-10H2,2-3H3,(H,21,22)(H,23,24)/t12-,13+,14-,17-,18+,19-,20-/m0/s1
|
|
InChIKey |
CZEMYYICWZPENF-VOLTXKGXSA-N
|
|
Synonyms |
Gibberellin A53; 51576-08-0; GA53; (1S,2S,3S,4R,8S,9S,12S)-12-hydroxy-4,8-dimethyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid; gibberellin 53; CHEBI:27433; DTXSID20331540; LMPR0104170007; (1S,2S,3S,4R,8S,9S,12S)-12-hydroxy-4,8-dimethyl-13-methylidenetetracyclo[10.2.1.0(1,9).0(3,8)]pentadecane-2,4-dicarboxylic acid; C06094; Q27103126; (1alpha,4aalpha,4bbeta,10beta)-7-hydroxy-1,4a-dimethyl-8-methylenegibbane-1,10-dicarboxylic acid; 7alpha-hydroxy-1beta,4a-dimethyl-8-methylidene-4aalpha,4bbeta-gibbane-1alpha,10beta-dicarboxylic acid
|
|
CAS | 51576-08-0 | |
PubChem CID | 440914 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 348.4 | ALogp: | 2.2 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 94.8 | Aromatic Rings: | 4 |
Heavy Atoms: | 25 | QED Weighted: | 0.659 |
Caco-2 Permeability: | -6.051 | MDCK Permeability: | 0.00003460 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.119 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.066 |
30% Bioavailability (F30%): | 0.014 |
Blood-Brain-Barrier Penetration (BBB): | 0.382 | Plasma Protein Binding (PPB): | 47.24% |
Volume Distribution (VD): | 0.354 | Fu: | 44.31% |
CYP1A2-inhibitor: | 0.003 | CYP1A2-substrate: | 0.893 |
CYP2C19-inhibitor: | 0.008 | CYP2C19-substrate: | 0.165 |
CYP2C9-inhibitor: | 0.01 | CYP2C9-substrate: | 0.08 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.1 |
CYP3A4-inhibitor: | 0.379 | CYP3A4-substrate: | 0.02 |
Clearance (CL): | 1.487 | Half-life (T1/2): | 0.239 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.599 |
Drug-inuced Liver Injury (DILI): | 0.036 | AMES Toxicity: | 0.018 |
Rat Oral Acute Toxicity: | 0.198 | Maximum Recommended Daily Dose: | 0.332 |
Skin Sensitization: | 0.066 | Carcinogencity: | 0.554 |
Eye Corrosion: | 0.398 | Eye Irritation: | 0.144 |
Respiratory Toxicity: | 0.979 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002541 | 0.529 | D01CKY | 0.283 | ||||
ENC000143 | 0.500 | D0R7JT | 0.273 | ||||
ENC002556 | 0.483 | D0IX6I | 0.266 | ||||
ENC002542 | 0.467 | D0KR5B | 0.266 | ||||
ENC003143 | 0.463 | D00HWO | 0.265 | ||||
ENC002902 | 0.452 | D0I2SD | 0.262 | ||||
ENC005547 | 0.452 | D0X4RS | 0.259 | ||||
ENC003162 | 0.425 | D0Q6NZ | 0.255 | ||||
ENC001844 | 0.409 | D04GJN | 0.250 | ||||
ENC002923 | 0.390 | D08TEJ | 0.246 |