|
Name |
3,7,11,15-Tetramethyl-2-hexadecen-1-OL
|
Molecular Formula | C20H40O | |
IUPAC Name* |
(E)-3,7,11,15-tetramethylhexadec-2-en-1-ol
|
|
SMILES |
CC(C)CCCC(C)CCCC(C)CCC/C(=C/CO)/C
|
|
InChI |
InChI=1S/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3/b20-15+
|
|
InChIKey |
BOTWFXYSPFMFNR-HMMYKYKNSA-N
|
|
Synonyms |
Phytol; 3,7,11,15-TETRAMETHYL-2-HEXADECEN-1-OL; 7541-49-3; 3,7,11,15-Tetramethylhexadec-2-en-1-ol; 2-Hexadecen-1-ol, 3,7,11,15-tetramethyl-; (E)-3,7,11,15-tetramethylhexadec-2-en-1-ol; MFCD00151280; AI3-36488; Phytol, >=97%, FG; (2E)-3,7,11,15-tetramethylhexadec-2-en-1-ol; 3,7,11,15-teramethyl-2-hexadecene-1-ol-, (2E,7R,11R)-; 3,7,11,15-Tetramethyl-2-hexadecen-1-ol-, (2E,7R,11R)-; CHEMBL390773; AMY21944; s5121; AKOS008965402; CCG-267435; 253686-88-3; AS-47652; LS-14831; CS-0161167; 2-hexadecen-1-ol, 3,7,11,15-tetramethyl; EN300-16645; F14923; EN300-7399953; (2E)-3,7,11,15-Tetramethyl-2-hexadecen-1-ol; (E)-3,7,11,15-Tetramethyl-2-hexadecene-1-ol; Phytol 3,7,11,15-Tetramethyl-2-hexadecen-1-ol; W-108070; Z56347285; 3,7,11,15-Tetramethyl-2-hexadecen-1-ol (mixture of isomers); 4305EBEF-F02F-4CB0-985E-89469C273922
|
|
CAS | 7541-49-3 | |
PubChem CID | 5366244 | |
ChEMBL ID | CHEMBL390773 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 296.5 | ALogp: | 8.2 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 13 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 20.2 | Aromatic Rings: | 0 |
Heavy Atoms: | 21 | QED Weighted: | 0.393 |
Caco-2 Permeability: | -4.389 | MDCK Permeability: | 0.00001100 |
Pgp-inhibitor: | 0.027 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.605 |
30% Bioavailability (F30%): | 0.925 |
Blood-Brain-Barrier Penetration (BBB): | 0.399 | Plasma Protein Binding (PPB): | 98.55% |
Volume Distribution (VD): | 2.46 | Fu: | 2.06% |
CYP1A2-inhibitor: | 0.348 | CYP1A2-substrate: | 0.19 |
CYP2C19-inhibitor: | 0.327 | CYP2C19-substrate: | 0.097 |
CYP2C9-inhibitor: | 0.444 | CYP2C9-substrate: | 0.947 |
CYP2D6-inhibitor: | 0.113 | CYP2D6-substrate: | 0.047 |
CYP3A4-inhibitor: | 0.182 | CYP3A4-substrate: | 0.122 |
Clearance (CL): | 6.197 | Half-life (T1/2): | 0.147 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.038 |
Drug-inuced Liver Injury (DILI): | 0.037 | AMES Toxicity: | 0.001 |
Rat Oral Acute Toxicity: | 0.008 | Maximum Recommended Daily Dose: | 0.154 |
Skin Sensitization: | 0.969 | Carcinogencity: | 0.023 |
Eye Corrosion: | 0.846 | Eye Irritation: | 0.932 |
Respiratory Toxicity: | 0.06 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001818 | 0.743 | D00FSV | 0.558 | ||||
ENC001412 | 0.743 | D05XQE | 0.258 | ||||
ENC000766 | 0.689 | D0ZI4H | 0.225 | ||||
ENC000538 | 0.683 | D0D9NY | 0.224 | ||||
ENC000354 | 0.682 | D03LGY | 0.222 | ||||
ENC000902 | 0.667 | D0X4FM | 0.211 | ||||
ENC000537 | 0.639 | D05QNO | 0.207 | ||||
ENC000441 | 0.632 | D03JSJ | 0.205 | ||||
ENC001286 | 0.612 | D0N3NO | 0.202 | ||||
ENC000627 | 0.606 | D0T9TJ | 0.202 |