|
Name |
Neophytadiene
|
Molecular Formula | C20H38 | |
IUPAC Name* |
7,11,15-trimethyl-3-methylidenehexadec-1-ene
|
|
SMILES |
CC(C)CCCC(C)CCCC(C)CCCC(=C)C=C
|
|
InChI |
InChI=1S/C20H38/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3/h7,17,19-20H,1,4,8-16H2,2-3,5-6H3
|
|
InChIKey |
NIDGCIPAMWNKOA-UHFFFAOYSA-N
|
|
Synonyms |
NEOPHYTADIENE; 504-96-1; 7,11,15-trimethyl-3-methylidenehexadec-1-ene; 2-(4,8,12-Trimethyltridecyl)buta-1,3-diene; 1-Hexadecene, 7,11,15-trimethyl-3-methylene-; 3-Methylene-7,11,15-trimethylhexadec-1-ene; HL3QFB56FB; 1,3-Butadiene, 2-(4,8,12-trimethyltridecyl)-; 3-METHYLENE-7,11,15-TRIMETHYL-1-HEXADECENE; HSDB 4321; Neophytadiene (80%); UNII-HL3QFB56FB; 7,11,15-Trimethyl-3-methylene-1-hexadecene; 2-(4,8,12-Trimethyltridecyl)-1,3-butadiene; Neophytadiene (80per cent); 7,11,15-trimethyl-3-methylidene-hexadec-1-ene; DTXSID40964657; CHEBI:145817; EX-A2765; HY-N8534; AKOS030254489; CS-0145915; FT-0672681; 7,11,15-Trimethyl-3-methylenehexadec-1-ene; Q67880018; 2-(4,8,12-TRIMETHYLTRIDECYL)BUTA-1,3-DIENE [HSDB]
|
|
CAS | 504-96-1 | |
PubChem CID | 10446 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 278.5 | ALogp: | 9.6 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 13 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 0.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 20 | QED Weighted: | 0.314 |
Caco-2 Permeability: | -4.628 | MDCK Permeability: | 0.00000544 |
Pgp-inhibitor: | 0.154 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.359 |
Blood-Brain-Barrier Penetration (BBB): | 0.513 | Plasma Protein Binding (PPB): | 98.55% |
Volume Distribution (VD): | 3.743 | Fu: | 1.67% |
CYP1A2-inhibitor: | 0.442 | CYP1A2-substrate: | 0.2 |
CYP2C19-inhibitor: | 0.352 | CYP2C19-substrate: | 0.557 |
CYP2C9-inhibitor: | 0.498 | CYP2C9-substrate: | 0.934 |
CYP2D6-inhibitor: | 0.058 | CYP2D6-substrate: | 0.072 |
CYP3A4-inhibitor: | 0.349 | CYP3A4-substrate: | 0.186 |
Clearance (CL): | 5.58 | Half-life (T1/2): | 0.043 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.055 |
Drug-inuced Liver Injury (DILI): | 0.856 | AMES Toxicity: | 0.013 |
Rat Oral Acute Toxicity: | 0.01 | Maximum Recommended Daily Dose: | 0.08 |
Skin Sensitization: | 0.965 | Carcinogencity: | 0.082 |
Eye Corrosion: | 0.977 | Eye Irritation: | 0.938 |
Respiratory Toxicity: | 0.904 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000766 | 0.695 | D00FSV | 0.450 | ||||
ENC001722 | 0.682 | D0ZI4H | 0.220 | ||||
ENC000538 | 0.661 | D0Z5BC | 0.216 | ||||
ENC000902 | 0.644 | D03LGY | 0.216 | ||||
ENC000537 | 0.644 | D0D9NY | 0.206 | ||||
ENC001286 | 0.615 | D0T9TJ | 0.197 | ||||
ENC000441 | 0.612 | D0N3NO | 0.196 | ||||
ENC001818 | 0.608 | D0G2KD | 0.196 | ||||
ENC001412 | 0.608 | D0X4FM | 0.194 | ||||
ENC000536 | 0.593 | D0K5WS | 0.189 |