|
Name |
9,11-Octadecadienoic acid
|
Molecular Formula | C18H32O2 | |
IUPAC Name* |
(9E,11E)-octadeca-9,11-dienoic acid
|
|
SMILES |
CCCCCC/C=C/C=C/CCCCCCCC(=O)O
|
|
InChI |
InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10H,2-6,11-17H2,1H3,(H,19,20)/b8-7+,10-9+
|
|
InChIKey |
JBYXPOFIGCOSSB-XBLVEGMJSA-N
|
|
Synonyms |
Isolinoleic acid; 544-71-8; Conjugated linoleic acid; 9,11-Octadecadienoic acid; 9,11-Linoleic acid; Ricineic acid; Nouracid DE 554; Mangold's acid; (9E,11E)-octadeca-9,11-dienoic acid; OCTADECA-9,11-DIENOIC ACID; Ricinenic acid; delta9,11-Octadecadienoic acid; 9(E),11(E)-Conjugated Linoleic Acid; 9E,11E-octadecadienoic acid; trans,trans-9,11-Octadecadienoicacid; 9-trans,11-trans-Octadecadienoic acid; 9t,11t-CLA; trans-9, trans-11-octadecadienoic acid; K3BO6AJ7F7; 1839-11-8; 9,11-Octadecadienoic acid, (E,E)-; 9,11-Octadecadienoic acid, (9E,11E)-; Conjugated linoleic acid (9Z,11E); C18:2n-7,9; NSC 7886; 9E,11E-CLA; Conjugated Linoleic Acid (9E,11E); Selin CLA; Conjugated (9E,11E)-Linoleic acid; (9E,11E)-9,11-Octadecadienoic acid; (E,E)-isolinoleic acid; 9E, 11E-Linoleic acid; UNII-K3BO6AJ7F7; 9-trans, 11-trans-CLA; Delta9,11-Octadecadienoate; SCHEMBL288695; CLA 80; CHEMBL4529739; (9E,11E)-Octadecadienoic acid; CHEBI:36025; CHEBI:88464; DTXSID60873030; Conjugated linoleic acid(9E,11E); 9(E),11(E)-Octadecadienoic acid; (E,E)-9,11-Octadecadienoic Acid; 9tr,11tr-OCTADECADIENOIC ACID; LMFA01030119; ZINC13949541; AKOS015911855; trans,trans-9,11-octadecadienoic acid; 9-trans,11-trans-conjugated linoleic acid; 250C473; A891827; J-015983; Q27116671; Q27160342; Conjugated (9E,11E)-Linoleic acid, analytical standard
|
|
CAS | 1839-11-8 | |
PubChem CID | 5282796 | |
ChEMBL ID | CHEMBL4529739 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 280.4 | ALogp: | 7.1 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 14 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 37.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 20 | QED Weighted: | 0.314 |
Caco-2 Permeability: | -4.834 | MDCK Permeability: | 0.00003320 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.495 |
30% Bioavailability (F30%): | 0.978 |
Blood-Brain-Barrier Penetration (BBB): | 0.038 | Plasma Protein Binding (PPB): | 98.64% |
Volume Distribution (VD): | 0.608 | Fu: | 0.98% |
CYP1A2-inhibitor: | 0.345 | CYP1A2-substrate: | 0.278 |
CYP2C19-inhibitor: | 0.259 | CYP2C19-substrate: | 0.392 |
CYP2C9-inhibitor: | 0.362 | CYP2C9-substrate: | 0.997 |
CYP2D6-inhibitor: | 0.095 | CYP2D6-substrate: | 0.903 |
CYP3A4-inhibitor: | 0.134 | CYP3A4-substrate: | 0.032 |
Clearance (CL): | 1.652 | Half-life (T1/2): | 0.638 |
hERG Blockers: | 0.123 | Human Hepatotoxicity (H-HT): | 0.037 |
Drug-inuced Liver Injury (DILI): | 0.065 | AMES Toxicity: | 0.01 |
Rat Oral Acute Toxicity: | 0.015 | Maximum Recommended Daily Dose: | 0.017 |
Skin Sensitization: | 0.938 | Carcinogencity: | 0.109 |
Eye Corrosion: | 0.924 | Eye Irritation: | 0.974 |
Respiratory Toxicity: | 0.915 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001544 | 1.000 | D0O1PH | 0.662 | ||||
ENC001099 | 0.831 | D0O1TC | 0.644 | ||||
ENC001762 | 0.800 | D0UE9X | 0.562 | ||||
ENC001552 | 0.781 | D0Z5BC | 0.500 | ||||
ENC001555 | 0.754 | D0OR6A | 0.468 | ||||
ENC001535 | 0.754 | D0XN8C | 0.450 | ||||
ENC005221 | 0.706 | D09SRR | 0.435 | ||||
ENC001775 | 0.701 | D07ILQ | 0.427 | ||||
ENC001554 | 0.700 | D05ATI | 0.387 | ||||
ENC001593 | 0.690 | D0I4DQ | 0.385 |