![]() |
Name |
9-Hexadecenoic acid
|
Molecular Formula | C16H30O2 | |
IUPAC Name* |
(E)-hexadec-9-enoic acid
|
|
SMILES |
CCCCCC/C=C/CCCCCCCC(=O)O
|
|
InChI |
InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/b8-7+
|
|
InChIKey |
SECPZKHBENQXJG-BQYQJAHWSA-N
|
|
Synonyms |
PALMITELAIDIC ACID; 9-HEXADECENOIC ACID; 10030-73-6; (E)-hexadec-9-enoic acid; 9-Hexadecenoic acid, (9E)-; trans-9-hexadecenoic acid; trans-palmitoleic acid; 2091-29-4; 9-trans-hexadecenoic acid; (E)-9-Hexadecenoic acid; (9E)-Hexadec-9-enoic acid; 9E-hexadecenoic acid; hexadec-9-enoic acid; t-9-hexadecenoic acid; trans-9-palmitoleic acid; (9E)-9-Hexadecenoic acid; CHEBI:59265; 65DJ825A3Z; Palmitolinoleic acid; DSSTox_CID_1603; trans-9-Hexadecenoate; DSSTox_RID_76230; DSSTox_GSID_21603; (9E)-hexadecenoic acid; 9-Hexadecenoic acid, (9Z)-; C16:1n-7; 9-Hexadecenoic acid, (E)-; CAS-10030-73-6; cis-.delta.9-Hexadecenoic acid; UNII-65DJ825A3Z; AI3-36444; NSC277452; NSC-277452; t-9-Hexadecenoate; 9-trans-Hexadecenoate; (E)-Palmitoleic acid; (E)-9-Hexadecenoate; (9E)-9-Hexadecenoate; (E)-9-hexadecenoicacid; 16:1 omega-7; 9-Trans-Palmitelaidic acid; SCHEMBL33311; C16:1 (trans-9) acid; SCHEMBL154754; (9E)-9-Hexadecenoic acid #; CHEMBL3182018; DTXSID7021603; PALMITOLEIC ACID, (E)-; CHEBI:72004; trans-Delta(9)-hexadecenoic acid; HY-N2341; Tox21_202178; Tox21_302976; LMFA01030057; MFCD00067230; t-16:1D9; ZINC14881154; AKOS015893003; CS-6346; NCGC00249181-01; NCGC00256330-01; NCGC00259727-01; AS-76823; J-000092; Q27139858; Q27888066
|
|
CAS | 10030-73-6 | |
PubChem CID | 5282745 | |
ChEMBL ID | CHEMBL3182018 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 254.41 | ALogp: | 6.4 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 13 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 37.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 18 | QED Weighted: | 0.344 |
Caco-2 Permeability: | -5.059 | MDCK Permeability: | 0.00003270 |
Pgp-inhibitor: | 0.009 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.015 | 20% Bioavailability (F20%): | 0.828 |
30% Bioavailability (F30%): | 0.936 |
Blood-Brain-Barrier Penetration (BBB): | 0.031 | Plasma Protein Binding (PPB): | 99.76% |
Volume Distribution (VD): | 0.503 | Fu: | 0.66% |
CYP1A2-inhibitor: | 0.251 | CYP1A2-substrate: | 0.196 |
CYP2C19-inhibitor: | 0.101 | CYP2C19-substrate: | 0.09 |
CYP2C9-inhibitor: | 0.296 | CYP2C9-substrate: | 0.991 |
CYP2D6-inhibitor: | 0.018 | CYP2D6-substrate: | 0.129 |
CYP3A4-inhibitor: | 0.036 | CYP3A4-substrate: | 0.022 |
Clearance (CL): | 2.373 | Half-life (T1/2): | 0.827 |
hERG Blockers: | 0.036 | Human Hepatotoxicity (H-HT): | 0.039 |
Drug-inuced Liver Injury (DILI): | 0.018 | AMES Toxicity: | 0.002 |
Rat Oral Acute Toxicity: | 0.018 | Maximum Recommended Daily Dose: | 0.023 |
Skin Sensitization: | 0.912 | Carcinogencity: | 0.05 |
Eye Corrosion: | 0.966 | Eye Irritation: | 0.971 |
Respiratory Toxicity: | 0.805 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001099 | ![]() |
1.000 | D0O1PH | ![]() |
0.773 | ||
ENC001555 | ![]() |
0.895 | D0O1TC | ![]() |
0.701 | ||
ENC001554 | ![]() |
0.846 | D0UE9X | ![]() |
0.612 | ||
ENC001535 | ![]() |
0.831 | D0Z5BC | ![]() |
0.554 | ||
ENC001544 | ![]() |
0.831 | D0OR6A | ![]() |
0.500 | ||
ENC001775 | ![]() |
0.831 | D0XN8C | ![]() |
0.486 | ||
ENC002845 | ![]() |
0.821 | D09SRR | ![]() |
0.482 | ||
ENC001593 | ![]() |
0.810 | D07ILQ | ![]() |
0.461 | ||
ENC001435 | ![]() |
0.780 | D05ATI | ![]() |
0.420 | ||
ENC001602 | ![]() |
0.742 | D0I4DQ | ![]() |
0.412 |