![]() |
Name |
botryospyrone B
|
Molecular Formula | C12H12O5 | |
IUPAC Name* |
8-hydroxy-5,6-dimethoxy-3-methylisochromen-1-one
|
|
SMILES |
COc1cc(O)c2c(=O)oc(C)cc2c1OC
|
|
InChI |
InChI=1S/C12H12O5/c1-6-4-7-10(12(14)17-6)8(13)5-9(15-2)11(7)16-3/h4-5,13H,1-3H3
|
|
InChIKey |
QWONVQPTHUEVQQ-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 236.22 | ALogp: | 1.8 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 68.9 | Aromatic Rings: | 2 |
Heavy Atoms: | 17 | QED Weighted: | 0.867 |
Caco-2 Permeability: | -4.756 | MDCK Permeability: | 0.00001770 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.008 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.104 |
Blood-Brain-Barrier Penetration (BBB): | 0.134 | Plasma Protein Binding (PPB): | 78.39% |
Volume Distribution (VD): | 0.783 | Fu: | 19.83% |
CYP1A2-inhibitor: | 0.957 | CYP1A2-substrate: | 0.969 |
CYP2C19-inhibitor: | 0.213 | CYP2C19-substrate: | 0.775 |
CYP2C9-inhibitor: | 0.209 | CYP2C9-substrate: | 0.876 |
CYP2D6-inhibitor: | 0.111 | CYP2D6-substrate: | 0.784 |
CYP3A4-inhibitor: | 0.109 | CYP3A4-substrate: | 0.308 |
Clearance (CL): | 6.897 | Half-life (T1/2): | 0.544 |
hERG Blockers: | 0.046 | Human Hepatotoxicity (H-HT): | 0.161 |
Drug-inuced Liver Injury (DILI): | 0.857 | AMES Toxicity: | 0.224 |
Rat Oral Acute Toxicity: | 0.24 | Maximum Recommended Daily Dose: | 0.084 |
Skin Sensitization: | 0.565 | Carcinogencity: | 0.041 |
Eye Corrosion: | 0.336 | Eye Irritation: | 0.939 |
Respiratory Toxicity: | 0.215 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004675 | ![]() |
0.712 | D0G4KG | ![]() |
0.435 | ||
ENC001940 | ![]() |
0.564 | D06GCK | ![]() |
0.386 | ||
ENC002113 | ![]() |
0.526 | D0AO5H | ![]() |
0.316 | ||
ENC006014 | ![]() |
0.526 | D0FA2O | ![]() |
0.310 | ||
ENC002134 | ![]() |
0.514 | D02LZB | ![]() |
0.287 | ||
ENC006031 | ![]() |
0.508 | D0Y7TS | ![]() |
0.287 | ||
ENC003472 | ![]() |
0.500 | D0D4HN | ![]() |
0.284 | ||
ENC001631 | ![]() |
0.493 | D0W8WB | ![]() |
0.280 | ||
ENC005162 | ![]() |
0.492 | D0C1SF | ![]() |
0.276 | ||
ENC003430 | ![]() |
0.486 | D07MGA | ![]() |
0.274 |