|
Name |
beta-Ocimene
|
Molecular Formula | C10H16 | |
IUPAC Name* |
(3E)-3,7-dimethylocta-1,3,6-triene
|
|
SMILES |
CC(=CC/C=C(\C)/C=C)C
|
|
InChI |
InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7-8H,1,6H2,2-4H3/b10-8+
|
|
InChIKey |
IHPKGUQCSIINRJ-CSKARUKUSA-N
|
|
Synonyms |
(E)-beta-ocimene; OCIMENE; trans-beta-Ocimene; 3779-61-1; (E)-3,7-Dimethylocta-1,3,6-triene; (3E)-3,7-dimethylocta-1,3,6-triene; 1,3,6-Octatriene, 3,7-dimethyl-; beta-Ocimene; 13877-91-3; trans-Ocimene; Ocimene, beta-; 3,7-DIMETHYL-1,3,6-OCTATRIENE; Ocimene trans-beta-form; 3,7-dimethyl-1,3E,6-octatriene; .beta.-Ocimene; 1,3,6-Octatriene, 3,7-dimethyl-, (E)-; (E)-Ocimene; FEMA No. 3539; .beta.-trans-Ocimene; trans-.beta.-Ocimene; Ocimene, trans-.beta.-; trans-3,7-Dimethyl-1,3,6-Octatriene; (3E)-3,7-Dimethyl-1,3,6-octatriene; (E)-3,7-Dimethyloctatriene; 38BQ4UYY06; 3,7-Dimethyl-1,3,6-octatriene (natural); CHEBI:64280; 3,7-DIMETHYLOCTA-1,3,6-TRIENE, (E)-; E-3,7-Dimethyl-1,3,6-octatriene; trans-3,7-dimethylocta-1,3,6-triene; UNII-38BQ4UYY06; UNII-V96I2PX4L5; 1,3,6-Octatriene,3,7-dimethyl-; p-Ocimene; Ocimene, trans; E-beta-Ocimene; beta-trans-Ocimene; t-.beta.-Ocimene; Ocimene (E); EINECS 223-241-5; EINECS 237-641-2; beta -trans-Ocimene; trans-beta -Ocimene; ocimene (e-beta-); (3E)-beta-ocimene; (E)-beta -Ocimene; beta -(E)-Ocimene; .beta.-(E)-Ocimene; (E)- .beta.-Ocimene; .beta.-Ocimene, (E)-; bmse000964; 1,3,6-Octatriene, 3,7-dimethyl-, (3E)-; 3,7-Dimethyl-(E)-Octatriene; V96I2PX4L5; CHEMBL2228374; DTXSID8040567; OCIMENE TRANS-.BETA.-FORM; .BETA.-OCIMENE, (3E)-; ZINC1531618; Octatriene, 3,7-dimethyl-, (E)-; AKOS015903787; (e)-3,7-dimethyl-1,3,6-octatriene; LMPR0102010021; 3,7-Dimethyl-(E)-1,3,6-Octatriene; beta-Ocimene 100 microg/mL in Methanol; OCIMENE TRANS-.BETA.-FORM [MI]; AS-80273; (3E)-3,7-dimethyl-octa-1,3,6-triene; DIMETHYL-1,3,6-OCTATRIENE [FHFI]; C09873; 3,7-DIMETHYLOCTA-1,3,6-TRIENE, (3E)-; J-007176; Q26777012
|
|
CAS | 3779-61-1 | |
PubChem CID | 5281553 | |
ChEMBL ID | CHEMBL2228374 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 136.23 | ALogp: | 4.3 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 10 | QED Weighted: | 0.402 |
Caco-2 Permeability: | -4.427 | MDCK Permeability: | 0.00003080 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.091 |
30% Bioavailability (F30%): | 0.436 |
Blood-Brain-Barrier Penetration (BBB): | 0.943 | Plasma Protein Binding (PPB): | 93.30% |
Volume Distribution (VD): | 3.872 | Fu: | 8.52% |
CYP1A2-inhibitor: | 0.777 | CYP1A2-substrate: | 0.581 |
CYP2C19-inhibitor: | 0.31 | CYP2C19-substrate: | 0.854 |
CYP2C9-inhibitor: | 0.082 | CYP2C9-substrate: | 0.906 |
CYP2D6-inhibitor: | 0.079 | CYP2D6-substrate: | 0.787 |
CYP3A4-inhibitor: | 0.047 | CYP3A4-substrate: | 0.259 |
Clearance (CL): | 13.401 | Half-life (T1/2): | 0.684 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.827 |
Drug-inuced Liver Injury (DILI): | 0.042 | AMES Toxicity: | 0.19 |
Rat Oral Acute Toxicity: | 0.04 | Maximum Recommended Daily Dose: | 0.213 |
Skin Sensitization: | 0.892 | Carcinogencity: | 0.845 |
Eye Corrosion: | 0.976 | Eye Irritation: | 0.992 |
Respiratory Toxicity: | 0.925 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000526 | 1.000 | D0M1PQ | 0.268 | ||||
ENC001564 | 0.610 | D0H6VY | 0.240 | ||||
ENC001664 | 0.610 | D05XQE | 0.229 | ||||
ENC001566 | 0.500 | D09XWD | 0.213 | ||||
ENC002306 | 0.385 | D0S7WX | 0.186 | ||||
ENC001434 | 0.375 | D03VFL | 0.182 | ||||
ENC001424 | 0.375 | D0F1GS | 0.162 | ||||
ENC001718 | 0.368 | D0Z4NI | 0.162 | ||||
ENC001641 | 0.367 | D0Q6DX | 0.161 | ||||
ENC000314 | 0.360 | D06BLQ | 0.157 |