![]() |
Name |
1-(4-Hydroxyphenyl)ethane-1,2-diol
|
Molecular Formula | C8H10O3 | |
IUPAC Name* |
1-(4-hydroxyphenyl)ethane-1,2-diol
|
|
SMILES |
C1=CC(=CC=C1C(CO)O)O
|
|
InChI |
InChI=1S/C8H10O3/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4,8-11H,5H2
|
|
InChIKey |
VYRWCSXMABWFDW-UHFFFAOYSA-N
|
|
Synonyms |
1-(4-hydroxyphenyl)ethane-1,2-diol; 2380-75-8; 4-Hydroxyphenethylene glycol; 4-Hydroxyphenylglycol; para-Hydroxyphenethyleneglycol; 4-Hydroxystyrene 7,8-glycol; 1,2-Ethanediol, 1-(4-hydroxyphenyl)-; 4-hydroxyphenylethylene glycol; SCHEMBL950885; DTXSID10946602; CHEBI:125383; 2-hydroxy-2-(4-hydroxyphenyl)ethanol; CS-0127729; EN300-1695864; BRD-A26347577-001-01-3; Q27215818
|
|
CAS | 2380-75-8 | |
PubChem CID | 3081980 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 154.16 | ALogp: | -0.9 |
HBD: | 3 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 60.7 | Aromatic Rings: | 1 |
Heavy Atoms: | 11 | QED Weighted: | 0.59 |
Caco-2 Permeability: | -4.549 | MDCK Permeability: | 0.00016256 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.011 |
Human Intestinal Absorption (HIA): | 0.062 | 20% Bioavailability (F20%): | 0.966 |
30% Bioavailability (F30%): | 0.989 |
Blood-Brain-Barrier Penetration (BBB): | 0.159 | Plasma Protein Binding (PPB): | 27.70% |
Volume Distribution (VD): | 2.019 | Fu: | 68.60% |
CYP1A2-inhibitor: | 0.049 | CYP1A2-substrate: | 0.099 |
CYP2C19-inhibitor: | 0.031 | CYP2C19-substrate: | 0.339 |
CYP2C9-inhibitor: | 0.008 | CYP2C9-substrate: | 0.543 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.503 |
CYP3A4-inhibitor: | 0.019 | CYP3A4-substrate: | 0.2 |
Clearance (CL): | 10.057 | Half-life (T1/2): | 0.786 |
hERG Blockers: | 0.031 | Human Hepatotoxicity (H-HT): | 0.034 |
Drug-inuced Liver Injury (DILI): | 0.038 | AMES Toxicity: | 0.1 |
Rat Oral Acute Toxicity: | 0.62 | Maximum Recommended Daily Dose: | 0.016 |
Skin Sensitization: | 0.46 | Carcinogencity: | 0.077 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.866 |
Respiratory Toxicity: | 0.023 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002666 | ![]() |
1.000 | D03UOT | ![]() |
0.486 | ||
ENC006123 | ![]() |
0.523 | D0W1RY | ![]() |
0.419 | ||
ENC006122 | ![]() |
0.500 | D01CRB | ![]() |
0.413 | ||
ENC000173 | ![]() |
0.487 | D07MOX | ![]() |
0.378 | ||
ENC000350 | ![]() |
0.487 | D0O6IU | ![]() |
0.370 | ||
ENC001021 | ![]() |
0.444 | D00LFB | ![]() |
0.369 | ||
ENC000086 | ![]() |
0.444 | D0B3QM | ![]() |
0.367 | ||
ENC000006 | ![]() |
0.429 | D0U5QK | ![]() |
0.364 | ||
ENC000007 | ![]() |
0.425 | D0O3FG | ![]() |
0.361 | ||
ENC000676 | ![]() |
0.415 | D0Q9ON | ![]() |
0.357 |