![]() |
Name |
3,6-Dioxa-2,7-disilaoctane, 2,2,7,7-tetramethyl-4,5-diphenyl-
|
Molecular Formula | C20H30O2Si2 | |
IUPAC Name* |
(1,2-diphenyl-2-trimethylsilyloxyethoxy)-trimethylsilane
|
|
SMILES |
C[Si](C)(C)OC(C1=CC=CC=C1)C(C2=CC=CC=C2)O[Si](C)(C)C
|
|
InChI |
InChI=1S/C20H30O2Si2/c1-23(2,3)21-19(17-13-9-7-10-14-17)20(22-24(4,5)6)18-15-11-8-12-16-18/h7-16,19-20H,1-6H3
|
|
InChIKey |
ZMNZKKSIHKEAPE-UHFFFAOYSA-N
|
|
Synonyms |
Hydrobenzoin, 2TMS derivative; SCHEMBL6282856; alpha,beta-Bis(trimethylsilyloxy)bibenzyl; 2,2,7,7-Tetramethyl-4,5-diphenyl-3,6-dioxa-2,7-disilaoctane #; 3,6-Dioxa-2,7-disilaoctane, 2,2,7,7-tetramethyl-4,5-diphenyl-
|
|
CAS | NA | |
PubChem CID | 601548 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 358.6 | ALogp: | 6.2 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 18.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 24 | QED Weighted: | 0.549 |
Caco-2 Permeability: | -4.622 | MDCK Permeability: | 0.00001110 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.112 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 100.10% |
Volume Distribution (VD): | 1.591 | Fu: | 3.15% |
CYP1A2-inhibitor: | 0.254 | CYP1A2-substrate: | 0.95 |
CYP2C19-inhibitor: | 0.78 | CYP2C19-substrate: | 0.886 |
CYP2C9-inhibitor: | 0.937 | CYP2C9-substrate: | 0.83 |
CYP2D6-inhibitor: | 0.037 | CYP2D6-substrate: | 0.596 |
CYP3A4-inhibitor: | 0.246 | CYP3A4-substrate: | 0.829 |
Clearance (CL): | 1.882 | Half-life (T1/2): | 0.058 |
hERG Blockers: | 0.067 | Human Hepatotoxicity (H-HT): | 0.041 |
Drug-inuced Liver Injury (DILI): | 0.014 | AMES Toxicity: | 0.076 |
Rat Oral Acute Toxicity: | 0.006 | Maximum Recommended Daily Dose: | 0.055 |
Skin Sensitization: | 0.152 | Carcinogencity: | 0.203 |
Eye Corrosion: | 0.115 | Eye Irritation: | 0.914 |
Respiratory Toxicity: | 0.421 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000295 | ![]() |
0.400 | D0W2AN | ![]() |
0.471 | ||
ENC000093 | ![]() |
0.354 | D01FGR | ![]() |
0.458 | ||
ENC000461 | ![]() |
0.350 | D0J5RN | ![]() |
0.412 | ||
ENC000077 | ![]() |
0.345 | D07HQC | ![]() |
0.412 | ||
ENC001523 | ![]() |
0.322 | D0W6DY | ![]() |
0.407 | ||
ENC001449 | ![]() |
0.315 | D08HRJ | ![]() |
0.404 | ||
ENC000732 | ![]() |
0.314 | D0X9MP | ![]() |
0.400 | ||
ENC001737 | ![]() |
0.312 | D0HQ6N | ![]() |
0.381 | ||
ENC000326 | ![]() |
0.310 | D0D9FV | ![]() |
0.367 | ||
ENC001050 | ![]() |
0.308 | D04CRN | ![]() |
0.360 |