![]() |
Name |
Phenyramidol hydrochloride
|
Molecular Formula | C13H15ClN2O | |
IUPAC Name* |
1-phenyl-2-(pyridin-2-ylamino)ethanol;hydrochloride
|
|
SMILES |
C1=CC=C(C=C1)C(CNC2=CC=CC=N2)O.Cl
|
|
InChI |
InChI=1S/C13H14N2O.ClH/c16-12(11-6-2-1-3-7-11)10-15-13-8-4-5-9-14-13;/h1-9,12,16H,10H2,(H,14,15);1H
|
|
InChIKey |
HYYDHUILGLWOOP-UHFFFAOYSA-N
|
|
Synonyms |
Phenyramidol hydrochloride; Fenyramidol hydrochloride; 326-43-2; Verbanol; Analexin; Betapirin; Firmalgil; Vazalmin; Phenyramidol HCl; Abbolexin; Miodar; Elan; NSC-17777; Phenylramidol hydrochloride; Fenyramidol hcl; Phenyramidol hydrochloride [USAN]; IN 511; MJ 505; 1-phenyl-2-(pyridin-2-ylamino)ethanol hydrochloride; Benzenemethanol, alpha-((2-pyridinylamino)methyl)-, monohydrochloride; M574V6XQH7; IN-511; Cabral hydrochloride; 326-43-2 (HCl); alpha-((2-Pyridylamino)methyl)benzyl alcohol monohydrochloride; ALPHA-[(2-PYRIDYLAMINO)METHYL]BENZYL ALCOHOL MONOHYDROCHLORIDE; 1-phenyl-2-(pyridin-2-ylamino)ethanol;hydrochloride; Evasprine hydrochloride; IN 511 hydrochloride; Phenyramidol Hydrochloride (USAN); NSC17777; EINECS 206-308-3; UNII-M574V6XQH7; alpha-((2-Pyridylamino)methyl)-benzyl alcohol hydrochloride; Benzyl alcohol, alpha-(2-pyridyl-aminomethyl)-, hydrochloride; SCHEMBL121004; CHEMBL1996759; WLN: T6NJ BM1YQR & GH; BENZYL ALCOHOL, alpha-((2-PYRIDYLAMINO)METHYL)-, MONOHYDROCHLORIDE; PHENYRAMIDOL HYDROCHLORIDE [MI]; FENYRAMIDOL HYDROCHLORIDE [MART.]; FENYRAMIDOL HYDROCHLORIDE [WHO-DD]; FT-0699784; D00755; 1-phenyl-2-(pyridin-2-ylamino)ethanolhydrochloride; Q27283510; 1-phenyl-2-[(pyridin-2-yl)amino]ethan-1-ol hydrochloride; .alpha.-[(2-Pyridylamino)methyl]benzyl alcohol hydrochloride; .alpha.-[(2-Pyridylamino)methyl]benzyl alcohol monohydrochloride; BENZENEMETHANOL, .ALPHA.-((2-PYRIDINYLAMINO)METHYL)-, MONOHYDROCHLORIDE
|
|
CAS | 326-43-2 | |
PubChem CID | 9469 | |
ChEMBL ID | CHEMBL1996759 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 250.72 | ALogp: | 2.6 |
HBD: | 3 | HBA: | 3 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 45.2 | Aromatic Rings: | 2 |
Heavy Atoms: | 17 | QED Weighted: | 0.874 |
Caco-2 Permeability: | -4.74 | MDCK Permeability: | 0.00002210 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.954 |
Human Intestinal Absorption (HIA): | 0.167 | 20% Bioavailability (F20%): | 0.948 |
30% Bioavailability (F30%): | 0.778 |
Blood-Brain-Barrier Penetration (BBB): | 0.425 | Plasma Protein Binding (PPB): | 49.89% |
Volume Distribution (VD): | 1.943 | Fu: | 45.98% |
CYP1A2-inhibitor: | 0.445 | CYP1A2-substrate: | 0.577 |
CYP2C19-inhibitor: | 0.173 | CYP2C19-substrate: | 0.102 |
CYP2C9-inhibitor: | 0.03 | CYP2C9-substrate: | 0.133 |
CYP2D6-inhibitor: | 0.939 | CYP2D6-substrate: | 0.73 |
CYP3A4-inhibitor: | 0.018 | CYP3A4-substrate: | 0.334 |
Clearance (CL): | 9.211 | Half-life (T1/2): | 0.551 |
hERG Blockers: | 0.08 | Human Hepatotoxicity (H-HT): | 0.339 |
Drug-inuced Liver Injury (DILI): | 0.038 | AMES Toxicity: | 0.019 |
Rat Oral Acute Toxicity: | 0.107 | Maximum Recommended Daily Dose: | 0.861 |
Skin Sensitization: | 0.193 | Carcinogencity: | 0.034 |
Eye Corrosion: | 0.01 | Eye Irritation: | 0.479 |
Respiratory Toxicity: | 0.974 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001033 | ![]() |
0.448 | D04OBB | ![]() |
0.493 | ||
ENC000295 | ![]() |
0.446 | D04CRN | ![]() |
0.392 | ||
ENC000173 | ![]() |
0.434 | D0B4JQ | ![]() |
0.392 | ||
ENC001375 | ![]() |
0.391 | D0Y2LR | ![]() |
0.382 | ||
ENC001449 | ![]() |
0.355 | D0J5RN | ![]() |
0.378 | ||
ENC000093 | ![]() |
0.348 | D07HQC | ![]() |
0.378 | ||
ENC001934 | ![]() |
0.345 | D01FGR | ![]() |
0.373 | ||
ENC001960 | ![]() |
0.345 | D0QV5T | ![]() |
0.367 | ||
ENC000047 | ![]() |
0.345 | D00IBN | ![]() |
0.366 | ||
ENC000321 | ![]() |
0.345 | D0D9FV | ![]() |
0.364 |