![]() |
Name |
11,12-Dioxatetracyclo[4.3.1.1(3,10).1(2,5)]dodecane
|
Molecular Formula | C10H14O2 | |
IUPAC Name* |
3,7-dioxatetracyclo[6.4.0.02,6.04,9]dodecane
|
|
SMILES |
C1CC2C3CC4C(O3)C(C1)C2O4
|
|
InChI |
InChI=1S/C10H14O2/c1-2-5-7-4-8-10(11-7)6(3-1)9(5)12-8/h5-10H,1-4H2
|
|
InChIKey |
NEXXPWJQUYBYNZ-UHFFFAOYSA-N
|
|
Synonyms |
11,12-Dioxatetracyclo[4.3.1.1(3,10).1(2,5)]dodecane
|
|
CAS | NA | |
PubChem CID | 565033 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 166.22 | ALogp: | 1.4 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 18.5 | Aromatic Rings: | 5 |
Heavy Atoms: | 12 | QED Weighted: | 0.546 |
Caco-2 Permeability: | -4.649 | MDCK Permeability: | 0.00006520 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.013 |
30% Bioavailability (F30%): | 0.31 |
Blood-Brain-Barrier Penetration (BBB): | 0.726 | Plasma Protein Binding (PPB): | 43.21% |
Volume Distribution (VD): | 1.844 | Fu: | 41.14% |
CYP1A2-inhibitor: | 0.062 | CYP1A2-substrate: | 0.739 |
CYP2C19-inhibitor: | 0.072 | CYP2C19-substrate: | 0.873 |
CYP2C9-inhibitor: | 0.03 | CYP2C9-substrate: | 0.14 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.651 |
CYP3A4-inhibitor: | 0.023 | CYP3A4-substrate: | 0.294 |
Clearance (CL): | 19.26 | Half-life (T1/2): | 0.138 |
hERG Blockers: | 0.047 | Human Hepatotoxicity (H-HT): | 0.261 |
Drug-inuced Liver Injury (DILI): | 0.397 | AMES Toxicity: | 0.114 |
Rat Oral Acute Toxicity: | 0.101 | Maximum Recommended Daily Dose: | 0.739 |
Skin Sensitization: | 0.281 | Carcinogencity: | 0.23 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.41 |
Respiratory Toxicity: | 0.969 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000767 | ![]() |
0.264 | D0N6FH | ![]() |
0.195 | ||
ENC002040 | ![]() |
0.241 | D02KIE | ![]() |
0.181 | ||
ENC002735 | ![]() |
0.229 | D0Y5ZA | ![]() |
0.181 | ||
ENC002243 | ![]() |
0.222 | D04URO | ![]() |
0.169 | ||
ENC004910 | ![]() |
0.219 | D0S3WH | ![]() |
0.165 | ||
ENC001198 | ![]() |
0.212 | D00VZZ | ![]() |
0.163 | ||
ENC001081 | ![]() |
0.211 | D00YWP | ![]() |
0.163 | ||
ENC003248 | ![]() |
0.203 | D0YS7D | ![]() |
0.161 | ||
ENC003403 | ![]() |
0.203 | D04CSZ | ![]() |
0.161 | ||
ENC001867 | ![]() |
0.203 | D0L0MK | ![]() |
0.160 |