![]() |
Name |
2H-Pyran-2-one, 5,6-dihydro-4-methyl-
|
Molecular Formula | C6H8O2 | |
IUPAC Name* |
4-methyl-2,3-dihydropyran-6-one
|
|
SMILES |
CC1=CC(=O)OCC1
|
|
InChI |
InChI=1S/C6H8O2/c1-5-2-3-8-6(7)4-5/h4H,2-3H2,1H3
|
|
InChIKey |
RPEASMBMVIKUTH-UHFFFAOYSA-N
|
|
Synonyms |
2381-87-5; 2H-Pyran-2-one, 5,6-dihydro-4-methyl-; 4-Methyl-5,6-dihydro-2H-pyran-2-one; 4-methyl-2,3-dihydropyran-6-one; 2H-Pyran-2-one,5,6-dihydro-4-methyl-; 2,3-Anhydromevalonic acid; Dehydromevalonic lactone; Dehydromevalonolactone; ghl.PD_Mitscher_leg0.315; SCHEMBL125458; DTXSID50178526; 4-methyl-5,6-dihydro-pyran-2-one; AKOS025296214; Mevalonic lactone, .DELTA.2-anhydro-; 5,6-dihydro-4-methyl-2h-pyran-2-one; 4-METHYL-5,6-DIHYDRO-2-PYRONE; AS-77246; 2,3-Anhydromevalonic acid .delta.-lactone; 4-Methyl-5,6-dihydro-2H-pyran-2-one #; D93039; 2-Pentenoic acid, 5-hydroxy-3-methyl-, lactone; EN300-21001769; Q63399355
|
|
CAS | 2381-87-5 | |
PubChem CID | 557445 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 112.13 | ALogp: | 0.6 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 8 | QED Weighted: | 0.441 |
Caco-2 Permeability: | -4.328 | MDCK Permeability: | 0.00003750 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.012 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.461 |
30% Bioavailability (F30%): | 0.549 |
Blood-Brain-Barrier Penetration (BBB): | 0.995 | Plasma Protein Binding (PPB): | 43.09% |
Volume Distribution (VD): | 0.735 | Fu: | 70.55% |
CYP1A2-inhibitor: | 0.898 | CYP1A2-substrate: | 0.689 |
CYP2C19-inhibitor: | 0.803 | CYP2C19-substrate: | 0.769 |
CYP2C9-inhibitor: | 0.295 | CYP2C9-substrate: | 0.696 |
CYP2D6-inhibitor: | 0.066 | CYP2D6-substrate: | 0.424 |
CYP3A4-inhibitor: | 0.049 | CYP3A4-substrate: | 0.269 |
Clearance (CL): | 5.526 | Half-life (T1/2): | 0.884 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.073 |
Drug-inuced Liver Injury (DILI): | 0.043 | AMES Toxicity: | 0.029 |
Rat Oral Acute Toxicity: | 0.071 | Maximum Recommended Daily Dose: | 0.341 |
Skin Sensitization: | 0.936 | Carcinogencity: | 0.453 |
Eye Corrosion: | 0.965 | Eye Irritation: | 0.992 |
Respiratory Toxicity: | 0.261 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005108 | ![]() |
1.000 | D0Z8AA | ![]() |
0.417 | ||
ENC002321 | ![]() |
0.567 | D0Q5MQ | ![]() |
0.194 | ||
ENC000165 | ![]() |
0.342 | D00EEL | ![]() |
0.186 | ||
ENC004122 | ![]() |
0.321 | D0U0KW | ![]() |
0.185 | ||
ENC000184 | ![]() |
0.300 | D0TY5N | ![]() |
0.180 | ||
ENC000146 | ![]() |
0.297 | D03CUF | ![]() |
0.175 | ||
ENC005910 | ![]() |
0.295 | D0N0OU | ![]() |
0.171 | ||
ENC005453 | ![]() |
0.280 | D0Z8SF | ![]() |
0.167 | ||
ENC004020 | ![]() |
0.268 | D0K7LU | ![]() |
0.164 | ||
ENC004712 | ![]() |
0.267 | D0L1WV | ![]() |
0.164 |