![]() |
Name |
4-Amino-1,2,5-oxadiazole-3-carbohydrazide
|
Molecular Formula | C3H5N5O2 | |
IUPAC Name* |
4-amino-1,2,5-oxadiazole-3-carbohydrazide
|
|
SMILES |
C1(=NON=C1N)C(=O)NN
|
|
InChI |
InChI=1S/C3H5N5O2/c4-2-1(3(9)6-5)7-10-8-2/h5H2,(H2,4,8)(H,6,9)
|
|
InChIKey |
ASQCREDXLDLPDJ-UHFFFAOYSA-N
|
|
Synonyms |
4-Amino-1,2,5-oxadiazole-3-carbohydrazide; 246048-72-6; 4-Amino-1,2,5-oxadiazol-3-carbohydrazide; 1,2,5-Oxadiazole-3-carboxylic acid, 4-amino-, hydrazide; Oprea1_397873; 3-aminofurazan-4-carbohydrazide; SCHEMBL18249667; DTXSID60337480; ALBB-010461; ZINC3882149; Furazan-3-carbohydrazide, 4-amino-; BBL028722; MFCD00508456; STK744321; AKOS000297342; VS-08927; CS-0240225; 4-Amino-1,2,5-oxadiazole-3-carbohydrazide #; EN300-226881
|
|
CAS | 246048-72-6 | |
PubChem CID | 543041 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 143.1 | ALogp: | -1.2 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 120.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 10 | QED Weighted: | 0.258 |
Caco-2 Permeability: | -5.512 | MDCK Permeability: | 0.00000608 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.175 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.009 |
Blood-Brain-Barrier Penetration (BBB): | 0.983 | Plasma Protein Binding (PPB): | 10.99% |
Volume Distribution (VD): | 0.836 | Fu: | 75.89% |
CYP1A2-inhibitor: | 0.58 | CYP1A2-substrate: | 0.328 |
CYP2C19-inhibitor: | 0.259 | CYP2C19-substrate: | 0.064 |
CYP2C9-inhibitor: | 0.023 | CYP2C9-substrate: | 0.099 |
CYP2D6-inhibitor: | 0.119 | CYP2D6-substrate: | 0.11 |
CYP3A4-inhibitor: | 0.063 | CYP3A4-substrate: | 0.15 |
Clearance (CL): | 3.35 | Half-life (T1/2): | 0.891 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.981 |
Drug-inuced Liver Injury (DILI): | 0.99 | AMES Toxicity: | 0.727 |
Rat Oral Acute Toxicity: | 0.735 | Maximum Recommended Daily Dose: | 0.09 |
Skin Sensitization: | 0.837 | Carcinogencity: | 0.965 |
Eye Corrosion: | 0.098 | Eye Irritation: | 0.965 |
Respiratory Toxicity: | 0.986 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000067 | ![]() |
0.167 | D09XQF | ![]() |
0.250 | ||
ENC000352 | ![]() |
0.167 | D0I0RJ | ![]() |
0.222 | ||
ENC000650 | ![]() |
0.163 | D0E1SW | ![]() |
0.173 | ||
ENC003710 | ![]() |
0.145 | D02XBW | ![]() |
0.167 | ||
ENC000111 | ![]() |
0.143 | D0C8EU | ![]() |
0.161 | ||
ENC000103 | ![]() |
0.143 | D06OAV | ![]() |
0.158 | ||
ENC000011 | ![]() |
0.143 | D0XF8W | ![]() |
0.156 | ||
ENC001108 | ![]() |
0.143 | D07CWD | ![]() |
0.152 | ||
ENC000467 | ![]() |
0.140 | D0I2VK | ![]() |
0.152 | ||
ENC000303 | ![]() |
0.140 | D01BQK | ![]() |
0.152 |