![]() |
Name |
4-(1,1,3,3-Tetramethylbutyl)phenyl trimethylsilyl ether
|
Molecular Formula | C17H30OSi | |
IUPAC Name* |
trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane
|
|
SMILES |
CC(C)(C)CC(C)(C)C1=CC=C(C=C1)O[Si](C)(C)C
|
|
InChI |
InChI=1S/C17H30OSi/c1-16(2,3)13-17(4,5)14-9-11-15(12-10-14)18-19(6,7)8/h9-12H,13H2,1-8H3
|
|
InChIKey |
LGVXTVHRVKVONW-UHFFFAOYSA-N
|
|
Synonyms |
Trimethyl[4-(1,1,3,3,-tetramethylbutyl)phenoxy]silane; Trimethyl(4-(2,4,4-trimethylpentan-2-yl)phenoxy)silane; 78721-87-6; Phenol, 4-tert.-octyl, TMS; SCHEMBL16047207; 4-(1,1,3,3-Tetramethylbutyl)phenyl trimethylsilyl ether; trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane; 4-tert-Octylphenol, TMS derivative; trimethyl(4-(1,1,3,3-tetramethylbutyl)phenoxy)silane; 4-(1,1,3,3-Tetramethylbutyl)phenyl trimethylsilyl ether #
|
|
CAS | NA | |
PubChem CID | 528938 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 278.5 | ALogp: | 5.6 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 9.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 19 | QED Weighted: | 0.634 |
Caco-2 Permeability: | -4.681 | MDCK Permeability: | 0.00000982 |
Pgp-inhibitor: | 0.729 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.891 | 20% Bioavailability (F20%): | 0.838 |
30% Bioavailability (F30%): | 0.172 |
Blood-Brain-Barrier Penetration (BBB): | 0.26 | Plasma Protein Binding (PPB): | 98.94% |
Volume Distribution (VD): | 5.892 | Fu: | 1.26% |
CYP1A2-inhibitor: | 0.335 | CYP1A2-substrate: | 0.946 |
CYP2C19-inhibitor: | 0.748 | CYP2C19-substrate: | 0.936 |
CYP2C9-inhibitor: | 0.562 | CYP2C9-substrate: | 0.957 |
CYP2D6-inhibitor: | 0.097 | CYP2D6-substrate: | 0.694 |
CYP3A4-inhibitor: | 0.124 | CYP3A4-substrate: | 0.223 |
Clearance (CL): | 3.429 | Half-life (T1/2): | 0.074 |
hERG Blockers: | 0.09 | Human Hepatotoxicity (H-HT): | 0.018 |
Drug-inuced Liver Injury (DILI): | 0.035 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.007 | Maximum Recommended Daily Dose: | 0.122 |
Skin Sensitization: | 0.483 | Carcinogencity: | 0.034 |
Eye Corrosion: | 0.962 | Eye Irritation: | 0.986 |
Respiratory Toxicity: | 0.068 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000309 | ![]() |
0.600 | D00NJL | ![]() |
0.378 | ||
ENC000838 | ![]() |
0.536 | D06YPU | ![]() |
0.313 | ||
ENC000152 | ![]() |
0.373 | D0J5DC | ![]() |
0.296 | ||
ENC000898 | ![]() |
0.349 | D0QC3M | ![]() |
0.287 | ||
ENC000744 | ![]() |
0.338 | D02LTL | ![]() |
0.282 | ||
ENC005113 | ![]() |
0.338 | D01JFT | ![]() |
0.253 | ||
ENC000185 | ![]() |
0.338 | D0EJ6O | ![]() |
0.247 | ||
ENC001123 | ![]() |
0.317 | D06CDO | ![]() |
0.242 | ||
ENC001392 | ![]() |
0.307 | D0B4DC | ![]() |
0.232 | ||
ENC000611 | ![]() |
0.299 | D01HKL | ![]() |
0.223 |