|
Name |
Phyllostine
|
Molecular Formula | C7H6O4 | |
IUPAC Name* |
(1R,6S)-3-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione
|
|
SMILES |
C1=C(C(=O)[C@H]2[C@@H](C1=O)O2)CO
|
|
InChI |
InChI=1S/C7H6O4/c8-2-3-1-4(9)6-7(11-6)5(3)10/h1,6-8H,2H2/t6-,7+/m1/s1
|
|
InChIKey |
PLELZLHJHUZIGY-RQJHMYQMSA-N
|
|
Synonyms |
Phyllostine; 27270-89-9; (-)-Phyllostine; Epoxygentisylquinone; (1r,6s)-3-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione; 5,6-epoxygentisylquinone; B1K54WA3BP; (1R,6S)-3-(HYDROXYMETHYL)-7-OXABICYCLO(4.1.0)HEPT-3-ENE-2,5-DIONE; UNII-B1K54WA3BP; DTXSID60181723; CHEBI:145110; ZINC14654235; 7-Oxabicyclo(4.1.0)hept-3-ene-2,5-dione, 3-(hydroxymethyl)-, (1R)-; 7-OXABICYCLO(4.1.0)HEPT-3-ENE-2,5-DIONE, 3-(HYDROXYMETHYL)-, (1R,6S)-
|
|
CAS | 27270-89-9 | |
PubChem CID | 168678 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 154.12 | ALogp: | -0.7 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.9 | Aromatic Rings: | 2 |
Heavy Atoms: | 11 | QED Weighted: | 0.509 |
Caco-2 Permeability: | -4.923 | MDCK Permeability: | 0.00001230 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.063 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.042 | Plasma Protein Binding (PPB): | 30.26% |
Volume Distribution (VD): | 0.562 | Fu: | 53.19% |
CYP1A2-inhibitor: | 0.525 | CYP1A2-substrate: | 0.108 |
CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.139 |
CYP2C9-inhibitor: | 0.013 | CYP2C9-substrate: | 0.376 |
CYP2D6-inhibitor: | 0.033 | CYP2D6-substrate: | 0.278 |
CYP3A4-inhibitor: | 0.017 | CYP3A4-substrate: | 0.208 |
Clearance (CL): | 9.601 | Half-life (T1/2): | 0.876 |
hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.063 |
Drug-inuced Liver Injury (DILI): | 0.189 | AMES Toxicity: | 0.635 |
Rat Oral Acute Toxicity: | 0.981 | Maximum Recommended Daily Dose: | 0.712 |
Skin Sensitization: | 0.95 | Carcinogencity: | 0.492 |
Eye Corrosion: | 0.015 | Eye Irritation: | 0.94 |
Respiratory Toxicity: | 0.27 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000788 | 0.405 | D0Z8EX | 0.254 | ||||
ENC001016 | 0.317 | D0CL9S | 0.246 | ||||
ENC006061 | 0.255 | D09PZO | 0.246 | ||||
ENC003178 | 0.255 | D0TS1Z | 0.246 | ||||
ENC000120 | 0.246 | D0R2KF | 0.227 | ||||
ENC002664 | 0.244 | D0Y7DP | 0.226 | ||||
ENC003001 | 0.244 | D01XYJ | 0.224 | ||||
ENC005328 | 0.243 | D05RHI | 0.221 | ||||
ENC002506 | 0.239 | D03TGJ | 0.217 | ||||
ENC000101 | 0.239 | D0MM2L | 0.213 |