![]() |
Name |
Aristolone
|
Molecular Formula | C15H22O | |
IUPAC Name* |
(1aR,7R,7aR,7bS)-1,1,7,7a-tetramethyl-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-2-one
|
|
SMILES |
C[C@@H]1CCCC2=CC(=O)[C@@H]3[C@H]([C@@]12C)C3(C)C
|
|
InChI |
InChI=1S/C15H22O/c1-9-6-5-7-10-8-11(16)12-13(14(12,2)3)15(9,10)4/h8-9,12-13H,5-7H2,1-4H3/t9-,12-,13+,15+/m1/s1
|
|
InChIKey |
UGVIZCBJCSXBCJ-JWFUOXDNSA-N
|
|
Synonyms |
Aristolone; 25274-27-5; Aristofone; 6831-17-0; Aristol-9-en-8-one; (1aR,7R,7aR,7bS)-1,1,7,7a-tetramethyl-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-2-one; (?)-Aristolone; CHEMBL512374; HY-N1464A; DTXSID10987838; ZINC6030836; MFCD22479204; s9283; CCG-266712; AC-34518; CS-0019590; 2H-Cyclopropa(a)naphthalen-2-one, 1,1a,4,5,6,7,7a,7b-octahydro-1,1,7,7a-tetramethyl-, (1aalpha,7alpha,7aalpha,7balpha)-
|
|
CAS | 6831-17-0 | |
PubChem CID | 165536 | |
ChEMBL ID | CHEMBL512374 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 218.33 | ALogp: | 3.6 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 3 |
Heavy Atoms: | 16 | QED Weighted: | 0.592 |
Caco-2 Permeability: | -4.48 | MDCK Permeability: | 0.00002260 |
Pgp-inhibitor: | 0.585 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.926 |
30% Bioavailability (F30%): | 0.56 |
Blood-Brain-Barrier Penetration (BBB): | 0.975 | Plasma Protein Binding (PPB): | 69.01% |
Volume Distribution (VD): | 1.161 | Fu: | 28.06% |
CYP1A2-inhibitor: | 0.181 | CYP1A2-substrate: | 0.375 |
CYP2C19-inhibitor: | 0.448 | CYP2C19-substrate: | 0.835 |
CYP2C9-inhibitor: | 0.441 | CYP2C9-substrate: | 0.729 |
CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.558 |
CYP3A4-inhibitor: | 0.191 | CYP3A4-substrate: | 0.345 |
Clearance (CL): | 10.427 | Half-life (T1/2): | 0.272 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.109 |
Drug-inuced Liver Injury (DILI): | 0.237 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.694 | Maximum Recommended Daily Dose: | 0.682 |
Skin Sensitization: | 0.622 | Carcinogencity: | 0.211 |
Eye Corrosion: | 0.96 | Eye Irritation: | 0.893 |
Respiratory Toxicity: | 0.966 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001183 | ![]() |
0.585 | D0D2TN | ![]() |
0.289 | ||
ENC001834 | ![]() |
0.474 | D0H1QY | ![]() |
0.286 | ||
ENC000965 | ![]() |
0.410 | D0Z1XD | ![]() |
0.284 | ||
ENC001526 | ![]() |
0.354 | D0I5DS | ![]() |
0.275 | ||
ENC004208 | ![]() |
0.343 | D0L2LS | ![]() |
0.271 | ||
ENC001829 | ![]() |
0.333 | D0I2SD | ![]() |
0.261 | ||
ENC001437 | ![]() |
0.333 | D04SFH | ![]() |
0.261 | ||
ENC003477 | ![]() |
0.323 | D06XMU | ![]() |
0.259 | ||
ENC001408 | ![]() |
0.323 | D07BSQ | ![]() |
0.259 | ||
ENC003215 | ![]() |
0.313 | D0G8BV | ![]() |
0.259 |