|
Name |
Petasol
|
Molecular Formula | C15H22O2 | |
IUPAC Name* |
(3S,4aR,5R,6R)-6-hydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one
|
|
SMILES |
C[C@H]1[C@@H](CCC2=CC(=O)[C@@H](C[C@]12C)C(=C)C)O
|
|
InChI |
InChI=1S/C15H22O2/c1-9(2)12-8-15(4)10(3)13(16)6-5-11(15)7-14(12)17/h7,10,12-13,16H,1,5-6,8H2,2-4H3/t10-,12-,13+,15+/m0/s1
|
|
InChIKey |
AJFPOVBARCSOLH-MUYACECFSA-N
|
|
Synonyms |
Petasol; Sencathenone; 64236-38-0; (+)-Petasol; P6AF873M8W; (3S,4aR,5R,6R)-6-hydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one; 2(3H)-Naphthalenone, 4,4a,5,6,7,8-hexahydro-6-hydroxy-4a,5-dimethyl-3-(1-methylethenyl)-, (3S,4aR,5R,6R)-; UNII-P6AF873M8W; CHEMBL3581341; DTXSID70982783; 2(3H)-Naphthalenone, 4,4a,5,6,7,8-hexahydro-6-hydroxy-4a,5-dimethyl-3-(1-methylethenyl)-, (3S-(3alpha,4abeta,5beta,6alpha))-; Q27286286; 6-Hydroxy-4a,5-dimethyl-3-(prop-1-en-2-yl)-4,4a,5,6,7,8-hexahydronaphthalen-2(3H)-one; (3S,4aR,5R,6R)-6-hydroxy-3-isopropenyl-4a,5-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-one; 2(3H)-NAPHTHALENONE, 4,4A,5,6,7,8-HEXAHYDRO-6-HYDROXY-4A,5-DIMETHYL-3-(1-METHYLETHENYL)-, (3S-(3.ALPHA.,4A.BETA.,5.BETA.,6.ALPHA.))-
|
|
CAS | 64236-38-0 | |
PubChem CID | 5275907 | |
ChEMBL ID | CHEMBL3581341 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 234.33 | ALogp: | 2.8 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 37.3 | Aromatic Rings: | 2 |
Heavy Atoms: | 17 | QED Weighted: | 0.703 |
Caco-2 Permeability: | -4.655 | MDCK Permeability: | 0.00002250 |
Pgp-inhibitor: | 0.464 | Pgp-substrate: | 0.283 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.026 |
30% Bioavailability (F30%): | 0.049 |
Blood-Brain-Barrier Penetration (BBB): | 0.056 | Plasma Protein Binding (PPB): | 89.87% |
Volume Distribution (VD): | 1.233 | Fu: | 10.91% |
CYP1A2-inhibitor: | 0.709 | CYP1A2-substrate: | 0.881 |
CYP2C19-inhibitor: | 0.357 | CYP2C19-substrate: | 0.907 |
CYP2C9-inhibitor: | 0.088 | CYP2C9-substrate: | 0.703 |
CYP2D6-inhibitor: | 0.372 | CYP2D6-substrate: | 0.521 |
CYP3A4-inhibitor: | 0.096 | CYP3A4-substrate: | 0.592 |
Clearance (CL): | 6.054 | Half-life (T1/2): | 0.783 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.417 |
Drug-inuced Liver Injury (DILI): | 0.183 | AMES Toxicity: | 0.083 |
Rat Oral Acute Toxicity: | 0.372 | Maximum Recommended Daily Dose: | 0.45 |
Skin Sensitization: | 0.916 | Carcinogencity: | 0.713 |
Eye Corrosion: | 0.159 | Eye Irritation: | 0.636 |
Respiratory Toxicity: | 0.967 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002230 | 0.574 | D04SFH | 0.314 | ||||
ENC005061 | 0.463 | D0KR5B | 0.303 | ||||
ENC004127 | 0.417 | D06XMU | 0.300 | ||||
ENC005064 | 0.409 | D07BSQ | 0.298 | ||||
ENC001924 | 0.387 | D0D2TN | 0.297 | ||||
ENC001832 | 0.387 | D0Z1XD | 0.293 | ||||
ENC005063 | 0.368 | D0I1LH | 0.286 | ||||
ENC001829 | 0.365 | D0CZ1Q | 0.283 | ||||
ENC001437 | 0.365 | D0L2LS | 0.279 | ||||
ENC003665 | 0.365 | D0CW1P | 0.277 |