![]() |
Name |
2-Cyclohexen-1-ol, 1-methyl-4-(1-methylethyl)-, trans-
|
Molecular Formula | C10H18O | |
IUPAC Name* |
(1R,4S)-1-methyl-4-propan-2-ylcyclohex-2-en-1-ol
|
|
SMILES |
CC(C)[C@@H]1CC[C@@](C=C1)(C)O
|
|
InChI |
InChI=1S/C10H18O/c1-8(2)9-4-6-10(3,11)7-5-9/h4,6,8-9,11H,5,7H2,1-3H3/t9-,10-/m0/s1
|
|
InChIKey |
IZXYHAXVIZHGJV-UWVGGRQHSA-N
|
|
Synonyms |
2-Cyclohexen-1-ol, 1-methyl-4-(1-methylethyl)-, trans-; 29803-81-4; trans-4-(Isopropyl)-1-methylcyclohex-2-en-1-ol; cis-p-menth-2-en-1-ol; 2-Cyclohexen-1-ol, 1-methyl-4-(1-methylethyl)-, (1R,4S)-rel-; 4-Isopropyl-1-methyl-2-cyclohexen-1-ol; EINECS 249-859-5; trans-p-Menth-2-enol; t-p-Menth-2-en-1-ol; trans-p-2-Menthen-1-ol; trans-p-Ment-2-en-1-ol; (E)-p-2-Menthen-1-ol; trans-p-Menth-2-ene-1-ol; trans-p-Mentha-2-en-1-ol; (E)-p-menth-2-en-1-ol; p-Menth-2-en-1-ol, trans; trans-para-Menth-2-en-1-ol; (E)-p-Mentha-2-en-1-ol; trans-para-Menth-2-ene-1-ol; (1R,4S)-1-methyl-4-propan-2-ylcyclohex-2-en-1-ol; Menth-2-en-1-ol (trans-p); Menth-2-en-1-ol- trans-para; SCHEMBL4978490; trans-1-Methyl-4-(1-methylethyl)-2-cyclohexen-1-ol; (1r,4s)-p-menth-2-en-1-ol; ZINC6036018; (1R,4S)-4-Isopropyl-1-methylcyclohex-2-enol; 1-Methyl-4-(methylethyl)-(E)-2-cyclohexenol; 4-Isopropyl-1-methyl-2-cyclohexen-1-ol, (E)-; trans-2-Cyclohexene-1-ol-1-methyl-4(1-methylethyl)
|
|
CAS | 29803-81-4 | |
PubChem CID | 122484 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 154.25 | ALogp: | 2.3 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 11 | QED Weighted: | 0.575 |
Caco-2 Permeability: | -4.139 | MDCK Permeability: | 0.00002470 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.045 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.011 |
30% Bioavailability (F30%): | 0.07 |
Blood-Brain-Barrier Penetration (BBB): | 0.918 | Plasma Protein Binding (PPB): | 81.49% |
Volume Distribution (VD): | 1.169 | Fu: | 17.62% |
CYP1A2-inhibitor: | 0.223 | CYP1A2-substrate: | 0.766 |
CYP2C19-inhibitor: | 0.179 | CYP2C19-substrate: | 0.863 |
CYP2C9-inhibitor: | 0.085 | CYP2C9-substrate: | 0.26 |
CYP2D6-inhibitor: | 0.019 | CYP2D6-substrate: | 0.194 |
CYP3A4-inhibitor: | 0.384 | CYP3A4-substrate: | 0.458 |
Clearance (CL): | 7.562 | Half-life (T1/2): | 0.542 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.031 |
Drug-inuced Liver Injury (DILI): | 0.111 | AMES Toxicity: | 0.016 |
Rat Oral Acute Toxicity: | 0.063 | Maximum Recommended Daily Dose: | 0.019 |
Skin Sensitization: | 0.142 | Carcinogencity: | 0.421 |
Eye Corrosion: | 0.94 | Eye Irritation: | 0.984 |
Respiratory Toxicity: | 0.02 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002264 | ![]() |
1.000 | D04CSZ | ![]() |
0.261 | ||
ENC000852 | ![]() |
0.487 | D07QKN | ![]() |
0.245 | ||
ENC000383 | ![]() |
0.400 | D0H1QY | ![]() |
0.208 | ||
ENC001292 | ![]() |
0.349 | D0K7LU | ![]() |
0.200 | ||
ENC003266 | ![]() |
0.348 | D01CKY | ![]() |
0.195 | ||
ENC004915 | ![]() |
0.348 | D05GKD | ![]() |
0.188 | ||
ENC002065 | ![]() |
0.333 | D06GIP | ![]() |
0.184 | ||
ENC000196 | ![]() |
0.333 | D08KVZ | ![]() |
0.176 | ||
ENC000653 | ![]() |
0.318 | D0P0HT | ![]() |
0.174 | ||
ENC001281 | ![]() |
0.311 | D0V8HA | ![]() |
0.173 |