![]() |
Name |
Methyl 2,3-anhydro-4,6-O-benzylidenehexopyranoside
|
Molecular Formula | C14H16O5 | |
IUPAC Name* |
5-methoxy-10-phenyl-3,6,9,11-tetraoxatricyclo[5.4.0.02,4]undecane
|
|
SMILES |
COC1C2C(O2)C3C(O1)COC(O3)C4=CC=CC=C4
|
|
InChI |
InChI=1S/C14H16O5/c1-15-14-12-11(18-12)10-9(17-14)7-16-13(19-10)8-5-3-2-4-6-8/h2-6,9-14H,7H2,1H3
|
|
InChIKey |
HQTCRHINASMQOA-UHFFFAOYSA-N
|
|
Synonyms |
Methyl 2,3-anhydro-4,6-O-benzylidenehexopyranoside; MLS002608315; NSC623664; 19465-13-5; 66537-92-6; NSC41444; EINECS 221-582-4; Methyl 2,3-anhydro-4,6-O-benzylidene-a-D-allopyranose; SCHEMBL4546279; CHEMBL1863752; DTXSID10941213; HMS3092F15; NSC41445; NSC 41444; NSC-41444; NSC-41445; NSC161077; NSC170222; NSC170243; AKOS024307001; NSC-161077; NSC-170222; NSC-170243; NSC-623664; SMR001527065; Methyl 2,6-o-benzylidene-d-mannopyranoside; D-Mannopyranoside,3-anhydro-4,6-O-(phenylmethylene)-; Mannopyranoside,3-anhydro-4,6-O-benzylidene-, .alpha.-D-; .alpha.-D-Mannopyranoside,3-anhydro-4,6-O-(phenylmethylene)-; 2-Phenyl-8-methoxy-9,10-epoxy-5,4-(epoxypropano)-1,3-dioxane; Methyl 2,3-anhydro-4,6-O-(benzylidene)-alpha-allo-D-pyranoside; Methyl 2,3-anhydro-4,6-O-[(R)-benzylidene]-a-D-allopyranoside; (1R,2R,4R,5S,7R)-5-methoxy-10-phenyl-3,6,9,11-tetraoxatricyclo[5.4.0.0^{2,4]undecane; 2-methoxy-6-phenyl-1a,2,3a,4,7a,7b-hexahydrooxireno[[?]:[?]]pyrano[[?]][1,3]dioxine; 53270-02-3; 67226-04-4
|
|
CAS | 3150-15-0 | |
PubChem CID | 97796 | |
ChEMBL ID | CHEMBL1863752 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 264.27 | ALogp: | 0.9 |
HBD: | 0 | HBA: | 5 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.4 | Aromatic Rings: | 4 |
Heavy Atoms: | 19 | QED Weighted: | 0.761 |
Caco-2 Permeability: | -4.922 | MDCK Permeability: | 0.00007400 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.033 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.023 |
Blood-Brain-Barrier Penetration (BBB): | 0.526 | Plasma Protein Binding (PPB): | 42.88% |
Volume Distribution (VD): | 1.172 | Fu: | 43.82% |
CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.578 |
CYP2C19-inhibitor: | 0.043 | CYP2C19-substrate: | 0.614 |
CYP2C9-inhibitor: | 0.027 | CYP2C9-substrate: | 0.027 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.241 |
CYP3A4-inhibitor: | 0.009 | CYP3A4-substrate: | 0.277 |
Clearance (CL): | 1.08 | Half-life (T1/2): | 0.105 |
hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.11 |
Drug-inuced Liver Injury (DILI): | 0.844 | AMES Toxicity: | 0.85 |
Rat Oral Acute Toxicity: | 0.1 | Maximum Recommended Daily Dose: | 0.036 |
Skin Sensitization: | 0.226 | Carcinogencity: | 0.15 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.068 |
Respiratory Toxicity: | 0.171 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003359 | ![]() |
0.347 | D0M2MC | ![]() |
0.324 | ||
ENC001251 | ![]() |
0.328 | D0T6SU | ![]() |
0.315 | ||
ENC004862 | ![]() |
0.292 | D0H0HJ | ![]() |
0.313 | ||
ENC000207 | ![]() |
0.274 | D0B7YT | ![]() |
0.293 | ||
ENC002302 | ![]() |
0.269 | D05ZJG | ![]() |
0.287 | ||
ENC002401 | ![]() |
0.261 | D0M6VK | ![]() |
0.287 | ||
ENC005321 | ![]() |
0.259 | D04LHJ | ![]() |
0.284 | ||
ENC005608 | ![]() |
0.258 | D0D4IH | ![]() |
0.276 | ||
ENC000917 | ![]() |
0.254 | D02KIE | ![]() |
0.272 | ||
ENC000174 | ![]() |
0.254 | D06BYV | ![]() |
0.267 |