![]() |
Name |
Methyl tetracosanoate
|
Molecular Formula | C25H50O2 | |
IUPAC Name* |
methyl tetracosanoate
|
|
SMILES |
CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC
|
|
InChI |
InChI=1S/C25H50O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25(26)27-2/h3-24H2,1-2H3
|
|
InChIKey |
XUDJZDNUVZHSKZ-UHFFFAOYSA-N
|
|
Synonyms |
Methyl tetracosanoate; 2442-49-1; Methyl lignocerate; Lignoceric acid methyl ester; Tetracosanoic acid, methyl ester; Methyl tetracosanoic acid; LIGNOCERICACIDMETHYLESTER; Tetracosanoic Acid Methyl Ester; lignoceric methyl ester; Tetracosanoic acid-methyl ester; HY5564B8FX; UNII-HY5564B8FX; Tetracosanoic acid,methyl ester; EINECS 219-475-2; MFCD00009351; Tetracosanoic acid methyl; SCHEMBL863540; DTXSID50179174; CDAA-251024M; CHEBI:143590; CAA44249; HY-N8438; ZINC70455481; AKOS015903349; AS-59413; Methyl tetracosanoate, analytical standard; DB-046446; Tetracosanoic acid methyl ester (FAME MIX); CS-0144211; FT-0634286; L0112; T72146; Methyl tetracosanoate, >=99.0% (capillary GC); J-015516; Q24762827; 2450B6FA-63F4-4631-86DE-6CDF98A1449A
|
|
CAS | 2442-49-1 | |
PubChem CID | 75546 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 382.7 | ALogp: | 12.3 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 23 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 27 | QED Weighted: | 0.124 |
Caco-2 Permeability: | -5.103 | MDCK Permeability: | 0.00000670 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.88 |
30% Bioavailability (F30%): | 1 |
Blood-Brain-Barrier Penetration (BBB): | 0.033 | Plasma Protein Binding (PPB): | 97.06% |
Volume Distribution (VD): | 3.814 | Fu: | 1.10% |
CYP1A2-inhibitor: | 0.08 | CYP1A2-substrate: | 0.161 |
CYP2C19-inhibitor: | 0.18 | CYP2C19-substrate: | 0.056 |
CYP2C9-inhibitor: | 0.057 | CYP2C9-substrate: | 0.966 |
CYP2D6-inhibitor: | 0.211 | CYP2D6-substrate: | 0.024 |
CYP3A4-inhibitor: | 0.229 | CYP3A4-substrate: | 0.025 |
Clearance (CL): | 4.59 | Half-life (T1/2): | 0.067 |
hERG Blockers: | 0.526 | Human Hepatotoxicity (H-HT): | 0.019 |
Drug-inuced Liver Injury (DILI): | 0.505 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.012 | Maximum Recommended Daily Dose: | 0.016 |
Skin Sensitization: | 0.972 | Carcinogencity: | 0.03 |
Eye Corrosion: | 0.945 | Eye Irritation: | 0.911 |
Respiratory Toxicity: | 0.81 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000553 | ![]() |
0.929 | D00AOJ | ![]() |
0.747 | ||
ENC000464 | ![]() |
0.923 | D07ILQ | ![]() |
0.533 | ||
ENC000474 | ![]() |
0.846 | D00STJ | ![]() |
0.512 | ||
ENC000358 | ![]() |
0.814 | D00FGR | ![]() |
0.471 | ||
ENC000497 | ![]() |
0.808 | D0Z5SM | ![]() |
0.435 | ||
ENC000446 | ![]() |
0.805 | D0O1PH | ![]() |
0.412 | ||
ENC000433 | ![]() |
0.776 | D05ATI | ![]() |
0.374 | ||
ENC000282 | ![]() |
0.771 | D00MLW | ![]() |
0.361 | ||
ENC000280 | ![]() |
0.769 | D0Z1QC | ![]() |
0.348 | ||
ENC000442 | ![]() |
0.768 | D0T9TJ | ![]() |
0.344 |