|
Name |
Methyl hexacosanoate
|
Molecular Formula | C27H54O2 | |
IUPAC Name* |
methyl hexacosanoate
|
|
SMILES |
CCCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC
|
|
InChI |
InChI=1S/C27H54O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27(28)29-2/h3-26H2,1-2H3
|
|
InChIKey |
VHUJBYYFFWDLNM-UHFFFAOYSA-N
|
|
Synonyms |
METHYL HEXACOSANOATE; 5802-82-4; Hexacosanoic acid methyl ester; Hexacosanoic acid, methyl ester; Cerotic acid methyl ester; EINECS 227-355-6; MFCD00042895; SCHEMBL3504339; DTXSID80206745; CHEBI:192288; ZINC85836253; AKOS015903232; Methyl hexacosanoate, analytical standard; AS-57418; Hexacosanoic acid methyl ester (FAME MIX); FT-0751804; Methyl hexacosanoate, >=99% (capillary GC); F3B7AB53-096F-457F-8FC2-5090CC791BBB; Hexacosanoic acid-methyl ester 10 microg/mL in Methyl-tert-butyl ether
|
|
CAS | 5802-82-4 | |
PubChem CID | 22048 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 410.7 | ALogp: | 13.3 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 25 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 29 | QED Weighted: | 0.1 |
Caco-2 Permeability: | -5.16 | MDCK Permeability: | 0.00000503 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.828 |
30% Bioavailability (F30%): | 1 |
Blood-Brain-Barrier Penetration (BBB): | 0.019 | Plasma Protein Binding (PPB): | 97.39% |
Volume Distribution (VD): | 4.122 | Fu: | 0.99% |
CYP1A2-inhibitor: | 0.059 | CYP1A2-substrate: | 0.15 |
CYP2C19-inhibitor: | 0.139 | CYP2C19-substrate: | 0.054 |
CYP2C9-inhibitor: | 0.042 | CYP2C9-substrate: | 0.97 |
CYP2D6-inhibitor: | 0.146 | CYP2D6-substrate: | 0.019 |
CYP3A4-inhibitor: | 0.208 | CYP3A4-substrate: | 0.02 |
Clearance (CL): | 4.575 | Half-life (T1/2): | 0.046 |
hERG Blockers: | 0.623 | Human Hepatotoxicity (H-HT): | 0.016 |
Drug-inuced Liver Injury (DILI): | 0.524 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.01 | Maximum Recommended Daily Dose: | 0.017 |
Skin Sensitization: | 0.975 | Carcinogencity: | 0.026 |
Eye Corrosion: | 0.943 | Eye Irritation: | 0.901 |
Respiratory Toxicity: | 0.745 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000724 | 0.929 | D00AOJ | 0.697 | ||||
ENC000464 | 0.857 | D07ILQ | 0.500 | ||||
ENC000358 | 0.820 | D00STJ | 0.489 | ||||
ENC000434 | 0.818 | D00FGR | 0.445 | ||||
ENC000401 | 0.791 | D0Z5SM | 0.408 | ||||
ENC000474 | 0.786 | D0O1PH | 0.389 | ||||
ENC000433 | 0.784 | D0Z1QC | 0.351 | ||||
ENC001176 | 0.772 | D05ATI | 0.351 | ||||
ENC000435 | 0.766 | D00MLW | 0.344 | ||||
ENC000359 | 0.764 | D01NTX | 0.335 |