![]() |
Name |
4-Chloro-o-xylene
|
Molecular Formula | C8H9Cl | |
IUPAC Name* |
4-chloro-1,2-dimethylbenzene
|
|
SMILES |
CC1=C(C=C(C=C1)Cl)C
|
|
InChI |
InChI=1S/C8H9Cl/c1-6-3-4-8(9)5-7(6)2/h3-5H,1-2H3
|
|
InChIKey |
HNQLMBJUMVLFCF-UHFFFAOYSA-N
|
|
Synonyms |
4-Chloro-o-xylene; 615-60-1; 4-Chloro-1,2-dimethylbenzene; 3,4-Dimethylchlorobenzene; Benzene, 4-chloro-1,2-dimethyl-; 4-CHLORO-1,2-XYLENE; o-Xylene, 4-chloro-; 4-Chloro-ortho-xylene; QO24WAW04Q; 1-Chloro-3,4-dimethylbenzene; EINECS 210-438-6; UNII-QO24WAW04Q; MFCD00000596; 4-chloro ortho-xylene; 3,4-dimethyl-chlorobenzene; EC 210-438-6; SCHEMBL91997; HNQLMBJUMVLFCF-UHFFFAOYSA-; DTXSID50210470; ZINC1845972; AKOS015848977; AS-59460; CS-0204818; FT-0618237; EN300-106038; N11900; A833302; 4-Chloro-1,2-dimethylbenzene, technical grade, 90%; Q27287384
|
|
CAS | 615-60-1 | |
PubChem CID | 32886 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 140.61 | ALogp: | 3.8 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 9 | QED Weighted: | 0.515 |
Caco-2 Permeability: | -4.366 | MDCK Permeability: | 0.00001500 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.014 |
30% Bioavailability (F30%): | 0.451 |
Blood-Brain-Barrier Penetration (BBB): | 0.967 | Plasma Protein Binding (PPB): | 95.11% |
Volume Distribution (VD): | 2.292 | Fu: | 4.57% |
CYP1A2-inhibitor: | 0.968 | CYP1A2-substrate: | 0.945 |
CYP2C19-inhibitor: | 0.892 | CYP2C19-substrate: | 0.8 |
CYP2C9-inhibitor: | 0.334 | CYP2C9-substrate: | 0.769 |
CYP2D6-inhibitor: | 0.607 | CYP2D6-substrate: | 0.91 |
CYP3A4-inhibitor: | 0.101 | CYP3A4-substrate: | 0.505 |
Clearance (CL): | 9.284 | Half-life (T1/2): | 0.3 |
hERG Blockers: | 0.043 | Human Hepatotoxicity (H-HT): | 0.083 |
Drug-inuced Liver Injury (DILI): | 0.263 | AMES Toxicity: | 0.079 |
Rat Oral Acute Toxicity: | 0.036 | Maximum Recommended Daily Dose: | 0.124 |
Skin Sensitization: | 0.195 | Carcinogencity: | 0.516 |
Eye Corrosion: | 0.969 | Eye Irritation: | 0.994 |
Respiratory Toxicity: | 0.028 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000180 | ![]() |
0.600 | D07WEP | ![]() |
0.348 | ||
ENC000179 | ![]() |
0.438 | D08ZEB | ![]() |
0.341 | ||
ENC000498 | ![]() |
0.417 | D01JMC | ![]() |
0.326 | ||
ENC000552 | ![]() |
0.417 | D0X0RI | ![]() |
0.311 | ||
ENC000364 | ![]() |
0.412 | D01PJR | ![]() |
0.298 | ||
ENC000342 | ![]() |
0.389 | D06CDO | ![]() |
0.295 | ||
ENC000084 | ![]() |
0.389 | D06GIP | ![]() |
0.293 | ||
ENC001334 | ![]() |
0.378 | D0X4ZR | ![]() |
0.269 | ||
ENC000649 | ![]() |
0.378 | D09QDP | ![]() |
0.268 | ||
ENC000347 | ![]() |
0.359 | D05VIX | ![]() |
0.263 |