![]() |
Name |
2-Methylstyrene
|
Molecular Formula | C9H10 | |
IUPAC Name* |
1-ethenyl-2-methylbenzene
|
|
SMILES |
CC1=CC=CC=C1C=C
|
|
InChI |
InChI=1S/C9H10/c1-3-9-7-5-4-6-8(9)2/h3-7H,1H2,2H3
|
|
InChIKey |
NVZWEEGUWXZOKI-UHFFFAOYSA-N
|
|
Synonyms |
2-Methylstyrene; 611-15-4; 2-Vinyltoluene; 1-Methyl-2-vinylbenzene; o-Vinyltoluene; 1-Ethenyl-2-methylbenzene; O-METHYLSTYRENE; Styrene, o-methyl-; Benzene, 1-ethenyl-2-methyl-; 1-ethenyl-2-methyl-benzene; 9017-21-4; 556UO5CL44; 2-METHYLSTYRENE (STABILIZED WITH TBC); ortho-Methylstyrene; 25087-21-2; EINECS 210-256-7; 1-methyl-2-vinyl-benzene; BRN 1901764; UNII-556UO5CL44; o-methyl-styrene; MFCD00014936; 2-Ethenylmethylbenzene; (2-TOLYL)ETHENE; 2-Methyl-1-vinylbenzene; METHYLSTYRENE, O-; 4-05-00-01367 (Beilstein Handbook Reference); CHEMBL3427716; DTXSID2060599; HSDB 8457; NVZWEEGUWXZOKI-UHFFFAOYSA-; AMY13657; ZINC1435985; 2-Methylstyrene, >=95.0% (GC); AKOS005256969; LS-13610; CS-0110436; FT-0613082; M0259; T72704; A856582; Q2805872
|
|
CAS | 611-15-4 | |
PubChem CID | 11904 | |
ChEMBL ID | CHEMBL3427716 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 118.18 | ALogp: | 3.2 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 9 | QED Weighted: | 0.53 |
Caco-2 Permeability: | -4.359 | MDCK Permeability: | 0.00002660 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.013 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.876 | Plasma Protein Binding (PPB): | 86.94% |
Volume Distribution (VD): | 2.229 | Fu: | 11.17% |
CYP1A2-inhibitor: | 0.845 | CYP1A2-substrate: | 0.907 |
CYP2C19-inhibitor: | 0.45 | CYP2C19-substrate: | 0.856 |
CYP2C9-inhibitor: | 0.094 | CYP2C9-substrate: | 0.771 |
CYP2D6-inhibitor: | 0.07 | CYP2D6-substrate: | 0.903 |
CYP3A4-inhibitor: | 0.059 | CYP3A4-substrate: | 0.383 |
Clearance (CL): | 9.672 | Half-life (T1/2): | 0.555 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.045 |
Drug-inuced Liver Injury (DILI): | 0.324 | AMES Toxicity: | 0.096 |
Rat Oral Acute Toxicity: | 0.037 | Maximum Recommended Daily Dose: | 0.189 |
Skin Sensitization: | 0.712 | Carcinogencity: | 0.676 |
Eye Corrosion: | 0.979 | Eye Irritation: | 0.997 |
Respiratory Toxicity: | 0.083 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000028 | ![]() |
0.516 | D0T3NY | ![]() |
0.347 | ||
ENC000179 | ![]() |
0.516 | D06LYG | ![]() |
0.302 | ||
ENC000407 | ![]() |
0.471 | D07HBX | ![]() |
0.300 | ||
ENC000204 | ![]() |
0.455 | D03GET | ![]() |
0.298 | ||
ENC000365 | ![]() |
0.444 | D05OIS | ![]() |
0.297 | ||
ENC000917 | ![]() |
0.432 | D0T3LF | ![]() |
0.293 | ||
ENC000166 | ![]() |
0.429 | D05BMG | ![]() |
0.293 | ||
ENC000064 | ![]() |
0.406 | D06DLI | ![]() |
0.292 | ||
ENC000167 | ![]() |
0.390 | D0X9RY | ![]() |
0.282 | ||
ENC002323 | ![]() |
0.380 | D0U0RZ | ![]() |
0.279 |