![]() |
Name |
Isopropyl Myristate
|
Molecular Formula | C17H34O2 | |
IUPAC Name* |
propan-2-yl tetradecanoate
|
|
SMILES |
CCCCCCCCCCCCCC(=O)OC(C)C
|
|
InChI |
InChI=1S/C17H34O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(18)19-16(2)3/h16H,4-15H2,1-3H3
|
|
InChIKey |
AXISYYRBXTVTFY-UHFFFAOYSA-N
|
|
Synonyms |
ISOPROPYL MYRISTATE; 110-27-0; Isopropyl tetradecanoate; Tetradecanoic acid, 1-methylethyl ester; Estergel; Bisomel; Isomyst; Promyr; Deltyl Extra; propan-2-yl tetradecanoate; Kesscomir; Tegester; Wickenol 101; Sinnoester MIP; Crodamol IPM; Plymoutm IPM; Stepan D-50; Starfol IPM; Unimate IPM; Kessco IPM; Emcol-IM; Myristic acid isopropyl ester; Emerest 2314; 1-Methylethyl tetradecanoate; JA-FA IPM; FEMA No. 3556; Kessco isopropyl myristate; Crodamol I.P.M.; Tetradecanoic acid, isopropyl; Myristic acid, isopropyl ester; Isopropyl myristate [USAN]; Tetradecanoic acid, isopropyl ester; HSDB 626; NSC 406280; 1-Tridecanecarboxylic acid, isopropyl ester; Isopropyl tetradecanoic acid; Estergel (TN); methylethyl tetradecanoate; 0RE8K4LNJS; iso-Propyl N-tetradecanoate; NSC-406280; CHEBI:90027; Tetradecanoic acid methyethyl ester; 1405-98-7; NCGC00164071-01; Deltylextra; WE(2:0(1Me)/14:0); DSSTox_CID_6838; Isopropyl myristate, 98%; DSSTox_RID_78224; DSSTox_GSID_26838; Caswell No. 511E; CAS-110-27-0; EINECS 203-751-4; UNII-0RE8K4LNJS; MFCD00008982; EPA Pesticide Chemical Code 000207; BRN 1781127; Tegosoft M; Isopropyl myristate [USAN:NF]; Liponate IPM; Crodamol 1PM; isopropyl-myristate; Lexol IPM; Isopropyltetradecanoate; myristic acid isopropyl; Radia 7190; Isopropyl myristate (NF); EC 203-751-4; SCHEMBL2442; Myristic acid-isopropyl ester; Isopropyl myristate, >=98%; CHEMBL207602; IPM 90; DTXSID0026838; ISOPROPYL MYRISTATE [II]; ISOPROPYL MYRISTATE [MI]; WLN: 13VOY1&1; FEMA 3556; tetradecanoic acid isopropyl ester; ISOPROPYL MYRISTATE [FHFI]; ISOPROPYL MYRISTATE [HSDB]; ISOPROPYL MYRISTATE [INCI]; ISOPROPYL MYRISTATE [VANDF]; ISOPROPYL MYRISTATE [MART.]; ZINC8214588; Isopropyl myristate, >=90% (GC); Tox21_112080; Tox21_202065; Tox21_303171; ISOPROPYL MYRISTATE [USP-RS]; ISOPROPYL MYRISTATE [WHO-DD]; LMFA07010677; NSC406280; s2428; AKOS015902296; Tox21_112080_1; DB13966; NCGC00164071-02; NCGC00164071-03; NCGC00256937-01; NCGC00259614-01; ISOPROPYL MYRISTATE [EP MONOGRAPH]; LS-14615; DB-040910; HY-124190; CS-0085813; FT-0629053; M0481; MYRISTIC ACID, ISOPROPYL ALCOHOL ESTER; D02296; F71211; TETRADECONOIC ACID, 1-METHYLETHYL ESTER; EN300-25299830; Q416222; SR-01000944751; Isopropyl myristate, Vetec(TM) reagent grade, 98%; Q-201418; SR-01000944751-1; Isopropyl myristate, United States Pharmacopeia (USP) Reference Standard; TETRADECANOIC ACID,ISOPROPYL ESTER (MYRISTATE,ISOPROPYL ESTER); Isopropyl myristate, Pharmaceutical Secondary Standard; Certified Reference Material
|
|
CAS | 110-27-0 | |
PubChem CID | 8042 | |
ChEMBL ID | CHEMBL207602 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 270.5 | ALogp: | 7.2 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 14 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 19 | QED Weighted: | 0.312 |
Caco-2 Permeability: | -4.655 | MDCK Permeability: | 0.00001800 |
Pgp-inhibitor: | 0.077 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.001 | 20% Bioavailability (F20%): | 0.901 |
30% Bioavailability (F30%): | 0.975 |
Blood-Brain-Barrier Penetration (BBB): | 0.258 | Plasma Protein Binding (PPB): | 97.35% |
Volume Distribution (VD): | 1.709 | Fu: | 2.03% |
CYP1A2-inhibitor: | 0.42 | CYP1A2-substrate: | 0.191 |
CYP2C19-inhibitor: | 0.449 | CYP2C19-substrate: | 0.067 |
CYP2C9-inhibitor: | 0.282 | CYP2C9-substrate: | 0.951 |
CYP2D6-inhibitor: | 0.045 | CYP2D6-substrate: | 0.012 |
CYP3A4-inhibitor: | 0.24 | CYP3A4-substrate: | 0.076 |
Clearance (CL): | 5.603 | Half-life (T1/2): | 0.337 |
hERG Blockers: | 0.063 | Human Hepatotoxicity (H-HT): | 0.024 |
Drug-inuced Liver Injury (DILI): | 0.337 | AMES Toxicity: | 0.004 |
Rat Oral Acute Toxicity: | 0.023 | Maximum Recommended Daily Dose: | 0.015 |
Skin Sensitization: | 0.948 | Carcinogencity: | 0.084 |
Eye Corrosion: | 0.979 | Eye Irritation: | 0.971 |
Respiratory Toxicity: | 0.81 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000316 | ![]() |
0.898 | D07ILQ | ![]() |
0.548 | ||
ENC000604 | ![]() |
0.772 | D0Z5SM | ![]() |
0.529 | ||
ENC000560 | ![]() |
0.733 | D05ATI | ![]() |
0.515 | ||
ENC000642 | ![]() |
0.719 | D0O1PH | ![]() |
0.469 | ||
ENC000495 | ![]() |
0.719 | D0H2YX | ![]() |
0.447 | ||
ENC000548 | ![]() |
0.710 | D00MLW | ![]() |
0.442 | ||
ENC000271 | ![]() |
0.698 | D00FGR | ![]() |
0.438 | ||
ENC000378 | ![]() |
0.690 | D00AOJ | ![]() |
0.412 | ||
ENC001142 | ![]() |
0.677 | D0T9TJ | ![]() |
0.411 | ||
ENC001160 | ![]() |
0.677 | D0P1RL | ![]() |
0.409 |