|
Name |
Prenylterphenyllin D
|
Molecular Formula | C25H24O5 | |
IUPAC Name* |
2-(2,2-dimethylchromen-6-yl)-5-(4-hydroxyphenyl)-3,6-dimethoxyphenol
|
|
SMILES |
COc1cc(-c2ccc(O)cc2)c(OC)c(O)c1-c1ccc2c(c1)C=CC(C)(C)O2
|
|
InChI |
InChI=1S/C25H24O5/c1-25(2)12-11-16-13-17(7-10-20(16)30-25)22-21(28-3)14-19(24(29-4)23(22)27)15-5-8-18(26)9-6-15/h5-14,26-27H,1-4H3
|
|
InChIKey |
SECVFRPHIBGJSV-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 404.46 | ALogp: | 5.6 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 68.2 | Aromatic Rings: | 4 |
Heavy Atoms: | 30 | QED Weighted: | 0.576 |
Caco-2 Permeability: | -4.817 | MDCK Permeability: | 0.00001610 |
Pgp-inhibitor: | 0.982 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.017 |
Blood-Brain-Barrier Penetration (BBB): | 0.009 | Plasma Protein Binding (PPB): | 100.71% |
Volume Distribution (VD): | 0.551 | Fu: | 0.75% |
CYP1A2-inhibitor: | 0.873 | CYP1A2-substrate: | 0.873 |
CYP2C19-inhibitor: | 0.945 | CYP2C19-substrate: | 0.092 |
CYP2C9-inhibitor: | 0.856 | CYP2C9-substrate: | 0.946 |
CYP2D6-inhibitor: | 0.776 | CYP2D6-substrate: | 0.926 |
CYP3A4-inhibitor: | 0.726 | CYP3A4-substrate: | 0.756 |
Clearance (CL): | 4.073 | Half-life (T1/2): | 0.236 |
hERG Blockers: | 0.558 | Human Hepatotoxicity (H-HT): | 0.784 |
Drug-inuced Liver Injury (DILI): | 0.631 | AMES Toxicity: | 0.052 |
Rat Oral Acute Toxicity: | 0.094 | Maximum Recommended Daily Dose: | 0.302 |
Skin Sensitization: | 0.206 | Carcinogencity: | 0.409 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.035 |
Respiratory Toxicity: | 0.614 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005866 | 0.953 | D06GCK | 0.354 | ||||
ENC005039 | 0.660 | D06TJJ | 0.333 | ||||
ENC000826 | 0.638 | D0Q9ON | 0.319 | ||||
ENC005870 | 0.635 | D05HSC | 0.285 | ||||
ENC005871 | 0.635 | D06FOU | 0.277 | ||||
ENC002858 | 0.634 | D0W8WB | 0.276 | ||||
ENC002452 | 0.621 | D0V8HJ | 0.276 | ||||
ENC005868 | 0.604 | D08CCE | 0.274 | ||||
ENC002776 | 0.590 | D0AZ8C | 0.273 | ||||
ENC002011 | 0.587 | D07MGA | 0.272 |