|
Name |
Terphenyllin
|
Molecular Formula | C20H18O5 | |
IUPAC Name* |
2,5-bis(4-hydroxyphenyl)-3,6-dimethoxyphenol
|
|
SMILES |
COC1=C(C(=C(C(=C1)C2=CC=C(C=C2)O)OC)O)C3=CC=C(C=C3)O
|
|
InChI |
InChI=1S/C20H18O5/c1-24-17-11-16(12-3-7-14(21)8-4-12)20(25-2)19(23)18(17)13-5-9-15(22)10-6-13/h3-11,21-23H,1-2H3
|
|
InChIKey |
YNEMPXKRLPZFAX-UHFFFAOYSA-N
|
|
Synonyms |
Terphenyllin; 52452-60-5; CHEBI:67537; JSR23Q1DOZ; [1,1':4',1''-Terphenyl]-2',4,4''-triol, 3',6'-dimethoxy-; NSC-299114; 3',6'-dimethoxy-[1,1':4',1''-terphenyl]-2',4,4''-triol; (1,1':4',1''-Terphenyl)-2',4,4''-triol, 3',6'-dimethoxy-; 2,5-bis(4-hydroxyphenyl)-3,6-dimethoxyphenol; NSC 299114; UNII-JSR23Q1DOZ; CHEMBL1795466; DTXSID50200452; CCA45260; ZINC1871615; BDBM50457916; MFCD08274598; NSC299114; AKOS030213226; HY-119821; CS-0078073; 2,5-bis(4-hydroxyphenyl)-3,6-dimethoxy-phenol; Q27136006; 1,4-DIMETHOXY-2,4',4''-TRIHYDROXY-P-TERPHENYL; [1,1''-Terphenyl]-2',4,4''-triol, 3',6'-dimethoxy-; 3',6'-dimethoxy-1,1':4',1''-terphenyl-2',4,4''-triol; [1,1':4',1''-Terphenyl]-2',4,4''-triol,3',6'-dimethoxy-; NCGC00347799-02!2,5-bis(4-hydroxyphenyl)-3,6-dimethoxyphenol; 3',6'-DIMETHOXY(1,1':4',1''-TERPHENYL)-2',4,4''-TRIOL
|
|
CAS | 52452-60-5 | |
PubChem CID | 100437 | |
ChEMBL ID | CHEMBL1795466 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 338.4 | ALogp: | 4.1 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 79.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 25 | QED Weighted: | 0.64 |
Caco-2 Permeability: | -4.796 | MDCK Permeability: | 0.00001450 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.017 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.107 |
30% Bioavailability (F30%): | 0.067 |
Blood-Brain-Barrier Penetration (BBB): | 0.013 | Plasma Protein Binding (PPB): | 99.38% |
Volume Distribution (VD): | 0.575 | Fu: | 1.22% |
CYP1A2-inhibitor: | 0.93 | CYP1A2-substrate: | 0.859 |
CYP2C19-inhibitor: | 0.926 | CYP2C19-substrate: | 0.064 |
CYP2C9-inhibitor: | 0.688 | CYP2C9-substrate: | 0.951 |
CYP2D6-inhibitor: | 0.657 | CYP2D6-substrate: | 0.922 |
CYP3A4-inhibitor: | 0.681 | CYP3A4-substrate: | 0.474 |
Clearance (CL): | 7.955 | Half-life (T1/2): | 0.823 |
hERG Blockers: | 0.211 | Human Hepatotoxicity (H-HT): | 0.025 |
Drug-inuced Liver Injury (DILI): | 0.8 | AMES Toxicity: | 0.173 |
Rat Oral Acute Toxicity: | 0.216 | Maximum Recommended Daily Dose: | 0.028 |
Skin Sensitization: | 0.641 | Carcinogencity: | 0.123 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.72 |
Respiratory Toxicity: | 0.16 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005871 | 0.810 | D0Y2NE | 0.370 | ||||
ENC005869 | 0.810 | D09ZQN | 0.370 | ||||
ENC005870 | 0.810 | D0Q9ON | 0.364 | ||||
ENC005038 | 0.803 | D00LFB | 0.358 | ||||
ENC002755 | 0.803 | D06GCK | 0.350 | ||||
ENC005039 | 0.753 | D0JY8T | 0.323 | ||||
ENC002858 | 0.747 | D01XBA | 0.320 | ||||
ENC002776 | 0.663 | D06TJJ | 0.315 | ||||
ENC002452 | 0.663 | D03UOT | 0.314 | ||||
ENC005866 | 0.638 | D06LOQ | 0.308 |