|
Name |
Didehydrobisdethiobis(methylthio)gliotoxin
|
Molecular Formula | C15H18N2O4S2 | |
IUPAC Name* |
6-hydroxy-3-(hydroxymethyl)-2-methyl-3,10a-bis(methylsulfanyl)-10H-pyrazino[1,2-a]indole-1,4-dione
|
|
SMILES |
CSC1(CO)C(=O)N2c3c(O)cccc3CC2(SC)C(=O)N1C
|
|
InChI |
InChI=1S/C15H18N2O4S2/c1-16-12(20)14(22-2)7-9-5-4-6-10(19)11(9)17(14)13(21)15(16,8-18)23-3/h4-6,18-19H,7-8H2,1-3H3/t14?,15-/m1/s1
|
|
InChIKey |
BUSZSWVUELPPBM-YSSOQSIOSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 354.45 | ALogp: | 0.9 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 81.1 | Aromatic Rings: | 3 |
Heavy Atoms: | 23 | QED Weighted: | 0.851 |
Caco-2 Permeability: | -4.677 | MDCK Permeability: | 0.00002200 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.075 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.96 | Plasma Protein Binding (PPB): | 65.31% |
Volume Distribution (VD): | 0.798 | Fu: | 24.99% |
CYP1A2-inhibitor: | 0.106 | CYP1A2-substrate: | 0.452 |
CYP2C19-inhibitor: | 0.814 | CYP2C19-substrate: | 0.944 |
CYP2C9-inhibitor: | 0.786 | CYP2C9-substrate: | 0.632 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.087 |
CYP3A4-inhibitor: | 0.386 | CYP3A4-substrate: | 0.973 |
Clearance (CL): | 7.732 | Half-life (T1/2): | 0.448 |
hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.099 |
Drug-inuced Liver Injury (DILI): | 0.964 | AMES Toxicity: | 0.027 |
Rat Oral Acute Toxicity: | 0.332 | Maximum Recommended Daily Dose: | 0.004 |
Skin Sensitization: | 0.297 | Carcinogencity: | 0.062 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.005 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000993 | 0.512 | D08EOD | 0.256 | ||||
ENC003439 | 0.432 | D08UMH | 0.233 | ||||
ENC004869 | 0.376 | D07RGW | 0.233 | ||||
ENC003035 | 0.364 | D08NQZ | 0.227 | ||||
ENC004868 | 0.326 | D0H6QU | 0.227 | ||||
ENC003549 | 0.325 | D0E3WQ | 0.225 | ||||
ENC006009 | 0.308 | D0O6GC | 0.216 | ||||
ENC005509 | 0.308 | D02NSF | 0.216 | ||||
ENC005614 | 0.304 | D05AFR | 0.213 | ||||
ENC005613 | 0.304 | D0J2NK | 0.213 |