|
Name |
diaporthsin F
|
Molecular Formula | C13H20O6 | |
IUPAC Name* |
(7-methoxy-2-methyl-5,10-dioxooxecan-4-yl)acetate
|
|
SMILES |
COC1CCC(=O)OC(C)CC(OC(C)=O)C(=O)C1
|
|
InChI |
InChI=1S/C13H20O6/c1-8-6-12(19-9(2)14)11(15)7-10(17-3)4-5-13(16)18-8/h8,10,12H,4-7H2,1-3H3/t8-,10+,12-/m1/s1
|
|
InChIKey |
VWCGFRJVPRKCNX-UBHAPETDSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 272.3 | ALogp: | 1.0 |
HBD: | 0 | HBA: | 6 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 78.9 | Aromatic Rings: | 1 |
Heavy Atoms: | 19 | QED Weighted: | 0.708 |
Caco-2 Permeability: | -4.508 | MDCK Permeability: | 0.00006200 |
Pgp-inhibitor: | 0.858 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.973 |
Blood-Brain-Barrier Penetration (BBB): | 0.688 | Plasma Protein Binding (PPB): | 19.90% |
Volume Distribution (VD): | 0.58 | Fu: | 70.85% |
CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.077 |
CYP2C19-inhibitor: | 0.011 | CYP2C19-substrate: | 0.497 |
CYP2C9-inhibitor: | 0.004 | CYP2C9-substrate: | 0.239 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.168 |
CYP3A4-inhibitor: | 0.032 | CYP3A4-substrate: | 0.309 |
Clearance (CL): | 6.193 | Half-life (T1/2): | 0.916 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.57 |
Drug-inuced Liver Injury (DILI): | 0.796 | AMES Toxicity: | 0.024 |
Rat Oral Acute Toxicity: | 0.028 | Maximum Recommended Daily Dose: | 0.627 |
Skin Sensitization: | 0.112 | Carcinogencity: | 0.853 |
Eye Corrosion: | 0.798 | Eye Irritation: | 0.351 |
Respiratory Toxicity: | 0.021 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003836 | 0.333 | D0I5DS | 0.240 | ||||
ENC003473 | 0.333 | D0Q4SD | 0.239 | ||||
ENC002313 | 0.326 | D0X4RS | 0.238 | ||||
ENC005137 | 0.326 | D02DKD | 0.236 | ||||
ENC002312 | 0.326 | D0EP0C | 0.234 | ||||
ENC000238 | 0.321 | D0T6WT | 0.233 | ||||
ENC002048 | 0.318 | D0R7WU | 0.232 | ||||
ENC003827 | 0.311 | D09WYX | 0.230 | ||||
ENC003826 | 0.311 | D0I2SD | 0.227 | ||||
ENC003825 | 0.311 | D04SFH | 0.227 |