|
Name |
4-(3-Hydroxy-5-methylphenoxy)-2-(2-hydroxyethyl)-6-methylphenol
|
Molecular Formula | C16H18O4 | |
IUPAC Name* |
2-(2-hydroxyethyl)-4-(3-hydroxy-5-methylphenoxy)-6-methylphenol
|
|
SMILES |
Cc1cc(O)cc(Oc2cc(C)c(O)c(CCO)c2)c1
|
|
InChI |
InChI=1S/C16H18O4/c1-10-5-13(18)9-14(6-10)20-15-7-11(2)16(19)12(8-15)3-4-17/h5-9,17-19H,3-4H2,1-2H3
|
|
InChIKey |
CZUBRDDFHWCKPW-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 274.32 | ALogp: | 3.0 |
HBD: | 3 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 69.9 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.792 |
Caco-2 Permeability: | -4.971 | MDCK Permeability: | 0.00001410 |
Pgp-inhibitor: | 0.053 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.996 |
30% Bioavailability (F30%): | 0.988 |
Blood-Brain-Barrier Penetration (BBB): | 0.04 | Plasma Protein Binding (PPB): | 95.97% |
Volume Distribution (VD): | 0.417 | Fu: | 3.79% |
CYP1A2-inhibitor: | 0.913 | CYP1A2-substrate: | 0.871 |
CYP2C19-inhibitor: | 0.288 | CYP2C19-substrate: | 0.11 |
CYP2C9-inhibitor: | 0.258 | CYP2C9-substrate: | 0.885 |
CYP2D6-inhibitor: | 0.804 | CYP2D6-substrate: | 0.871 |
CYP3A4-inhibitor: | 0.221 | CYP3A4-substrate: | 0.246 |
Clearance (CL): | 13.83 | Half-life (T1/2): | 0.93 |
hERG Blockers: | 0.066 | Human Hepatotoxicity (H-HT): | 0.058 |
Drug-inuced Liver Injury (DILI): | 0.034 | AMES Toxicity: | 0.04 |
Rat Oral Acute Toxicity: | 0.163 | Maximum Recommended Daily Dose: | 0.959 |
Skin Sensitization: | 0.958 | Carcinogencity: | 0.433 |
Eye Corrosion: | 0.058 | Eye Irritation: | 0.956 |
Respiratory Toxicity: | 0.209 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005289 | 0.766 | D07MGA | 0.261 | ||||
ENC005291 | 0.681 | D04AIT | 0.256 | ||||
ENC005402 | 0.603 | D07EXH | 0.254 | ||||
ENC004643 | 0.594 | D03TPR | 0.253 | ||||
ENC002445 | 0.594 | D06RGG | 0.253 | ||||
ENC002944 | 0.577 | D0S5CH | 0.250 | ||||
ENC000979 | 0.574 | D0K8KX | 0.250 | ||||
ENC005185 | 0.506 | D02UFG | 0.250 | ||||
ENC003317 | 0.500 | D04XEG | 0.247 | ||||
ENC002964 | 0.494 | D0M8RC | 0.244 |