NPs Basic Information
|
Name |
Septoreremophilane F
|
| Molecular Formula | C15H18O5 | |
| IUPAC Name* |
3a,6,9a-trihydroxy-4a,5-dimethyl-3-methylidene-4,9-dihydrobenzo[f][1]benzofuran-7-one
|
|
| SMILES |
C=C1COC2(O)CC3=CC(=O)C(O)=C(C)C3(C)CC12O
|
|
| InChI |
InChI=1S/C15H18O5/c1-8-6-20-15(19)5-10-4-11(16)12(17)9(2)13(10,3)7-14(8,15)18/h4,17-19H,1,5-7H2,2-3H3/t13-,14-,15+/m1/s1
|
|
| InChIKey |
OAEQPULRWGJLRN-KFWWJZLASA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 278.3 | ALogp: | 1.1 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 87.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 20 | QED Weighted: | 0.586 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.851 | MDCK Permeability: | 0.00001890 |
| Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.067 | 20% Bioavailability (F20%): | 0.945 |
| 30% Bioavailability (F30%): | 0.009 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.92 | Plasma Protein Binding (PPB): | 58.83% |
| Volume Distribution (VD): | 0.561 | Fu: | 52.64% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.007 | CYP1A2-substrate: | 0.974 |
| CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.788 |
| CYP2C9-inhibitor: | 0.036 | CYP2C9-substrate: | 0.028 |
| CYP2D6-inhibitor: | 0.001 | CYP2D6-substrate: | 0.091 |
| CYP3A4-inhibitor: | 0.048 | CYP3A4-substrate: | 0.918 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 2.512 | Half-life (T1/2): | 0.164 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.124 |
| Drug-inuced Liver Injury (DILI): | 0.794 | AMES Toxicity: | 0.94 |
| Rat Oral Acute Toxicity: | 0.948 | Maximum Recommended Daily Dose: | 0.028 |
| Skin Sensitization: | 0.482 | Carcinogencity: | 0.921 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.353 |
| Respiratory Toxicity: | 0.974 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005056 |  |
0.552 | D0A2AJ |  |
0.212 | ||
| ENC005057 |  |
0.529 | D0G6AB |  |
0.211 | ||
| ENC005058 |  |
0.486 | D0IX6I |  |
0.204 | ||
| ENC005054 |  |
0.405 | D0IL7L |  |
0.204 | ||
| ENC005055 |  |
0.387 | D0I5DS |  |
0.200 | ||
| ENC002288 |  |
0.368 | D02NSF |  |
0.198 | ||
| ENC000709 |  |
0.287 | D0D1SG |  |
0.192 | ||
| ENC004487 |  |
0.281 | D0KR5B |  |
0.192 | ||
| ENC003911 |  |
0.278 | D0L2LS |  |
0.192 | ||
| ENC002356 |  |
0.277 | D0C8HR |  |
0.189 | ||