NPs Basic Information
|
Name |
Septoreremophilane D
|
| Molecular Formula | C15H20O4 | |
| IUPAC Name* |
3a,9a-dihydroxy-4a,5-dimethyl-3-methylidene-4,5,7,9-tetrahydrobenzo[f][1]benzofuran-6-one
|
|
| SMILES |
C=C1COC2(O)CC3=CCC(=O)C(C)C3(C)CC12O
|
|
| InChI |
InChI=1S/C15H20O4/c1-9-7-19-15(18)6-11-4-5-12(16)10(2)13(11,3)8-14(9,15)17/h4,10,17-18H,1,5-8H2,2-3H3/t10-,13+,14+,15-/m0/s1
|
|
| InChIKey |
ZSZRCONWEWPGJA-QOWREQOWSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 264.32 | ALogp: | 1.3 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 66.8 | Aromatic Rings: | 3 |
| Heavy Atoms: | 19 | QED Weighted: | 0.655 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.661 | MDCK Permeability: | 0.00001930 |
| Pgp-inhibitor: | 0.017 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.015 | 20% Bioavailability (F20%): | 0.98 |
| 30% Bioavailability (F30%): | 0.077 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.947 | Plasma Protein Binding (PPB): | 47.66% |
| Volume Distribution (VD): | 0.955 | Fu: | 58.37% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.007 | CYP1A2-substrate: | 0.974 |
| CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.794 |
| CYP2C9-inhibitor: | 0.025 | CYP2C9-substrate: | 0.051 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.161 |
| CYP3A4-inhibitor: | 0.107 | CYP3A4-substrate: | 0.767 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 5.338 | Half-life (T1/2): | 0.282 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.139 |
| Drug-inuced Liver Injury (DILI): | 0.229 | AMES Toxicity: | 0.709 |
| Rat Oral Acute Toxicity: | 0.974 | Maximum Recommended Daily Dose: | 0.036 |
| Skin Sensitization: | 0.036 | Carcinogencity: | 0.969 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.047 |
| Respiratory Toxicity: | 0.957 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005056 |  |
0.672 | D0G6AB |  |
0.284 | ||
| ENC005058 |  |
0.645 | D0IX6I |  |
0.245 | ||
| ENC005059 |  |
0.529 | D0I5DS |  |
0.240 | ||
| ENC005055 |  |
0.500 | D0IL7L |  |
0.232 | ||
| ENC005054 |  |
0.500 | D0A2AJ |  |
0.232 | ||
| ENC002288 |  |
0.478 | D0Z1XD |  |
0.217 | ||
| ENC003869 |  |
0.308 | D0X4RS |  |
0.215 | ||
| ENC003868 |  |
0.308 | D0K0EK |  |
0.209 | ||
| ENC002356 |  |
0.300 | D0L2LS |  |
0.208 | ||
| ENC003980 |  |
0.289 | D0KR5B |  |
0.208 | ||