NPs Basic Information
|
Name |
bipolatoxin C
|
| Molecular Formula | C25H36O3 | |
| IUPAC Name* |
8-(hydroxymethyl)-12-(6-hydroxy-6-methylhept-4-en-2-yl)-1,4-dimethyltricyclo[9.3.0.03,7]tetradeca-4,8,12-trien-6-one
|
|
| SMILES |
CC1=CC(=O)C2C(CO)=CCC3C(C(C)CC=CC(C)(C)O)=CCC3(C)CC12
|
|
| InChI |
InChI=1S/C25H36O3/c1-16(7-6-11-24(3,4)28)19-10-12-25(5)14-20-17(2)13-22(27)23(20)18(15-26)8-9-21(19)25/h6,8,10-11,13,16,20-21,23,26,28H,7,9,12,14-15H2,1-5H3/b11-6+,18-8-/t16-,20+,21-,23-,25-/m0/s1
|
|
| InChIKey |
YSAOFRNQGRWXTI-SSVQWNSUSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 384.56 | ALogp: | 4.8 |
| HBD: | 2 | HBA: | 3 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 57.5 | Aromatic Rings: | 3 |
| Heavy Atoms: | 28 | QED Weighted: | 0.642 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.543 | MDCK Permeability: | 0.00001530 |
| Pgp-inhibitor: | 0.944 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.047 | 20% Bioavailability (F20%): | 0.236 |
| 30% Bioavailability (F30%): | 0.079 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.969 | Plasma Protein Binding (PPB): | 84.35% |
| Volume Distribution (VD): | 2.243 | Fu: | 5.09% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.02 | CYP1A2-substrate: | 0.177 |
| CYP2C19-inhibitor: | 0.076 | CYP2C19-substrate: | 0.597 |
| CYP2C9-inhibitor: | 0.043 | CYP2C9-substrate: | 0.116 |
| CYP2D6-inhibitor: | 0.248 | CYP2D6-substrate: | 0.12 |
| CYP3A4-inhibitor: | 0.914 | CYP3A4-substrate: | 0.348 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 5.387 | Half-life (T1/2): | 0.051 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.034 |
| Drug-inuced Liver Injury (DILI): | 0.204 | AMES Toxicity: | 0.008 |
| Rat Oral Acute Toxicity: | 0.016 | Maximum Recommended Daily Dose: | 0.851 |
| Skin Sensitization: | 0.778 | Carcinogencity: | 0.944 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.019 |
| Respiratory Toxicity: | 0.948 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005044 |  |
0.670 | D0L7AS |  |
0.220 | ||
| ENC005045 |  |
0.566 | D02VPX |  |
0.219 | ||
| ENC005803 |  |
0.471 | D05BTM |  |
0.215 | ||
| ENC004222 |  |
0.418 | D02ZGI |  |
0.215 | ||
| ENC002271 |  |
0.417 | D0E9KA |  |
0.215 | ||
| ENC002981 |  |
0.413 | D0T2PL |  |
0.215 | ||
| ENC004488 |  |
0.402 | D0F7NQ |  |
0.200 | ||
| ENC004489 |  |
0.391 | D0A2AJ |  |
0.200 | ||
| ENC003777 |  |
0.389 | D0N1TP |  |
0.197 | ||
| ENC004491 |  |
0.368 | D00IUG |  |
0.196 | ||