|
Name |
Isomonodictyphenone
|
Molecular Formula | C15H12O6 | |
IUPAC Name* |
2-(2,6-dihydroxy-4-methylbenzoyl)-3-hydroxybenzoicacid
|
|
SMILES |
Cc1cc(O)c(C(=O)c2c(O)cccc2C(=O)O)c(O)c1
|
|
InChI |
InChI=1S/C15H12O6/c1-7-5-10(17)13(11(18)6-7)14(19)12-8(15(20)21)3-2-4-9(12)16/h2-6,16-18H,1H3,(H,20,21)
|
|
InChIKey |
KNXAGUANLPVZSV-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 288.25 | ALogp: | 2.0 |
HBD: | 4 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 115.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.645 |
Caco-2 Permeability: | -5.419 | MDCK Permeability: | 0.00000616 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.051 | 20% Bioavailability (F20%): | 0.713 |
30% Bioavailability (F30%): | 0.997 |
Blood-Brain-Barrier Penetration (BBB): | 0.077 | Plasma Protein Binding (PPB): | 99.61% |
Volume Distribution (VD): | 0.339 | Fu: | 1.03% |
CYP1A2-inhibitor: | 0.569 | CYP1A2-substrate: | 0.112 |
CYP2C19-inhibitor: | 0.059 | CYP2C19-substrate: | 0.044 |
CYP2C9-inhibitor: | 0.556 | CYP2C9-substrate: | 0.107 |
CYP2D6-inhibitor: | 0.333 | CYP2D6-substrate: | 0.126 |
CYP3A4-inhibitor: | 0.151 | CYP3A4-substrate: | 0.083 |
Clearance (CL): | 3.777 | Half-life (T1/2): | 0.823 |
hERG Blockers: | 0.031 | Human Hepatotoxicity (H-HT): | 0.208 |
Drug-inuced Liver Injury (DILI): | 0.987 | AMES Toxicity: | 0.86 |
Rat Oral Acute Toxicity: | 0.029 | Maximum Recommended Daily Dose: | 0.026 |
Skin Sensitization: | 0.696 | Carcinogencity: | 0.283 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.945 |
Respiratory Toxicity: | 0.35 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002362 | 0.867 | D00KRE | 0.398 | ||||
ENC005677 | 0.716 | D07HBX | 0.361 | ||||
ENC003644 | 0.692 | D0Y0JH | 0.346 | ||||
ENC005344 | 0.634 | D0Y7PG | 0.341 | ||||
ENC003620 | 0.569 | D08QJS | 0.340 | ||||
ENC002375 | 0.558 | D08LFZ | 0.329 | ||||
ENC000936 | 0.519 | D0GY5Z | 0.319 | ||||
ENC002109 | 0.488 | D0H2ZW | 0.315 | ||||
ENC003862 | 0.486 | D04AIT | 0.310 | ||||
ENC006012 | 0.481 | D09SOA | 0.309 |