|
Name |
9-ethyl-l,7-dioxaspiro[5.5]undecan-4-ol
|
Molecular Formula | C11H20O3 | |
IUPAC Name* |
9-ethyl-1,7-dioxaspiro[5.5]undecan-4-ol
|
|
SMILES |
CCC1CCC2(CC(O)CCO2)OC1
|
|
InChI |
InChI=1S/C11H20O3/c1-2-9-3-5-11(14-8-9)7-10(12)4-6-13-11/h9-10,12H,2-8H2,1H3/t9-,10+,11+/m1/s1
|
|
InChIKey |
OIGYLLOBLWMYOY-VWYCJHECSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 200.28 | ALogp: | 1.7 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 38.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.705 |
Caco-2 Permeability: | -4.467 | MDCK Permeability: | 0.00004130 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.438 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.018 |
30% Bioavailability (F30%): | 0.006 |
Blood-Brain-Barrier Penetration (BBB): | 0.82 | Plasma Protein Binding (PPB): | 29.34% |
Volume Distribution (VD): | 1.977 | Fu: | 57.10% |
CYP1A2-inhibitor: | 0.023 | CYP1A2-substrate: | 0.936 |
CYP2C19-inhibitor: | 0.033 | CYP2C19-substrate: | 0.878 |
CYP2C9-inhibitor: | 0.021 | CYP2C9-substrate: | 0.087 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.318 |
CYP3A4-inhibitor: | 0.021 | CYP3A4-substrate: | 0.486 |
Clearance (CL): | 15.061 | Half-life (T1/2): | 0.552 |
hERG Blockers: | 0.027 | Human Hepatotoxicity (H-HT): | 0.235 |
Drug-inuced Liver Injury (DILI): | 0.017 | AMES Toxicity: | 0.053 |
Rat Oral Acute Toxicity: | 0.013 | Maximum Recommended Daily Dose: | 0.591 |
Skin Sensitization: | 0.948 | Carcinogencity: | 0.678 |
Eye Corrosion: | 0.197 | Eye Irritation: | 0.955 |
Respiratory Toxicity: | 0.089 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000928 | 0.574 | D00ZTD | 0.200 | ||||
ENC000927 | 0.574 | D0K0EK | 0.193 | ||||
ENC002495 | 0.234 | D0SC8F | 0.190 | ||||
ENC002267 | 0.232 | D04VIS | 0.187 | ||||
ENC005065 | 0.229 | D05HXX | 0.186 | ||||
ENC005945 | 0.227 | D0N6FH | 0.185 | ||||
ENC004081 | 0.224 | D0M4WA | 0.184 | ||||
ENC004080 | 0.224 | D03DVJ | 0.183 | ||||
ENC003798 | 0.224 | D00YWP | 0.183 | ||||
ENC001172 | 0.221 | D08QMX | 0.183 |