NPs Basic Information
|
Name |
5R-hydroxyrecifeiolide
|
| Molecular Formula | C12H20O3 | |
| IUPAC Name* |
(6R,9E,12R)-6-hydroxy-12-methyl-1-oxacyclododec-9-en-2-one
|
|
| SMILES |
C[C@@H]1C/C=C/CC[C@@H](CCCC(=O)O1)O
|
|
| InChI |
InChI=1S/C12H20O3/c1-10-6-3-2-4-7-11(13)8-5-9-12(14)15-10/h2-3,10-11,13H,4-9H2,1H3/b3-2+/t10-,11+/m1/s1
|
|
| InChIKey |
PFYIIATUFRENPK-NTYHVHHESA-N
|
|
| Synonyms |
5R-hydroxyrecifeiolide
|
|
| CAS | NA | |
| PubChem CID | 146682963 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 212.28 | ALogp: | 2.1 |
| HBD: | 1 | HBA: | 3 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 46.5 | Aromatic Rings: | 1 |
| Heavy Atoms: | 15 | QED Weighted: | 0.496 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.555 | MDCK Permeability: | 0.00019712 |
| Pgp-inhibitor: | 0.489 | Pgp-substrate: | 0.064 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.019 |
| 30% Bioavailability (F30%): | 0.901 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.965 | Plasma Protein Binding (PPB): | 65.46% |
| Volume Distribution (VD): | 1.915 | Fu: | 30.57% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.354 | CYP1A2-substrate: | 0.227 |
| CYP2C19-inhibitor: | 0.107 | CYP2C19-substrate: | 0.12 |
| CYP2C9-inhibitor: | 0.064 | CYP2C9-substrate: | 0.906 |
| CYP2D6-inhibitor: | 0.047 | CYP2D6-substrate: | 0.249 |
| CYP3A4-inhibitor: | 0.12 | CYP3A4-substrate: | 0.153 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 6.376 | Half-life (T1/2): | 0.9 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.672 |
| Drug-inuced Liver Injury (DILI): | 0.055 | AMES Toxicity: | 0.01 |
| Rat Oral Acute Toxicity: | 0.014 | Maximum Recommended Daily Dose: | 0.959 |
| Skin Sensitization: | 0.958 | Carcinogencity: | 0.77 |
| Eye Corrosion: | 0.851 | Eye Irritation: | 0.823 |
| Respiratory Toxicity: | 0.11 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
 |
D0K0EK |  |
0.247 | ||||
|
D07GRH |  |
0.235 | ||||
|
D0C7JF |  |
0.224 | ||||
|
D00YWP |  |
0.222 | ||||
|
D00ZFP |  |
0.222 | ||||
|
D06XMU |  |
0.217 | ||||
|
D04JHN |  |
0.214 | ||||
|
D04SFH |  |
0.209 | ||||
|
D03YVO |  |
0.208 | ||||
|
D08QMX |  |
0.207 | ||||