NPs Basic Information
|
Name |
methyl 2-[2-[(Z)-but-2-en-2-yl]-3-chloro-6-hydroxy-4-methoxy-5-methylphenoxy]-3,5-dichloro-4-hydroxy-6-methylbenzoate
|
| Molecular Formula | C21H21Cl3O6 | |
| IUPAC Name* |
methyl 2-[2-[(Z)-but-2-en-2-yl]-3-chloro-6-hydroxy-4-methoxy-5-methylphenoxy]-3,5-dichloro-4-hydroxy-6-methylbenzoate
|
|
| SMILES |
C/C=C(/C)\C1=C(C(=C(C(=C1Cl)OC)C)O)OC2=C(C(=C(C(=C2C(=O)OC)C)Cl)O)Cl
|
|
| InChI |
InChI=1S/C21H21Cl3O6/c1-7-8(2)11-14(23)18(28-5)10(4)16(25)20(11)30-19-12(21(27)29-6)9(3)13(22)17(26)15(19)24/h7,25-26H,1-6H3/b8-7-
|
|
| InChIKey |
IHNJVMIKUHYAOO-FPLPWBNLSA-N
|
|
| Synonyms |
Diaryl ether
|
|
| CAS | NA | |
| PubChem CID | 156963344 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 475.7 | ALogp: | 6.8 |
| HBD: | 2 | HBA: | 6 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 85.2 | Aromatic Rings: | 2 |
| Heavy Atoms: | 30 | QED Weighted: | 0.473 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.905 | MDCK Permeability: | 0.00002100 |
| Pgp-inhibitor: | 0.212 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.161 | 20% Bioavailability (F20%): | 0.002 |
| 30% Bioavailability (F30%): | 0 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.012 | Plasma Protein Binding (PPB): | 102.03% |
| Volume Distribution (VD): | 0.563 | Fu: | 1.75% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.403 | CYP1A2-substrate: | 0.955 |
| CYP2C19-inhibitor: | 0.574 | CYP2C19-substrate: | 0.608 |
| CYP2C9-inhibitor: | 0.898 | CYP2C9-substrate: | 0.842 |
| CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.231 |
| CYP3A4-inhibitor: | 0.146 | CYP3A4-substrate: | 0.719 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 9.616 | Half-life (T1/2): | 0.106 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.619 |
| Drug-inuced Liver Injury (DILI): | 0.869 | AMES Toxicity: | 0.024 |
| Rat Oral Acute Toxicity: | 0.953 | Maximum Recommended Daily Dose: | 0.845 |
| Skin Sensitization: | 0.441 | Carcinogencity: | 0.227 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.907 |
| Respiratory Toxicity: | 0.572 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001415 |  |
0.462 | D0WY9N |  |
0.287 | ||
| ENC004141 |  |
0.425 | D0WN0U |  |
0.239 | ||
| ENC001395 |  |
0.404 | D06GCK |  |
0.225 | ||
| ENC004838 |  |
0.402 | D09ELP |  |
0.223 | ||
| ENC004226 |  |
0.398 | D0ZX2G |  |
0.220 | ||
| ENC003723 |  |
0.388 | D05QDC |  |
0.214 | ||
| ENC001976 |  |
0.375 | D09DHY |  |
0.206 | ||
| ENC005705 |  |
0.370 | D03RTK |  |
0.205 | ||
| ENC000632 |  |
0.368 | D0L5FY |  |
0.204 | ||
| ENC005937 |  |
0.358 | D0B1IP |  |
0.203 | ||