|
Name |
Solitumine A
|
Molecular Formula | C20H27N3O4 | |
IUPAC Name* |
(2S)-2-amino-5-[[(2S,3R)-2-(2-methylbut-3-en-2-yl)-4-oxo-2,3-dihydro-1H-quinolin-3-yl]methylamino]-5-oxopentanoic acid
|
|
SMILES |
CC(C)(C=C)[C@@H]1[C@H](C(=O)C2=CC=CC=C2N1)CNC(=O)CC[C@@H](C(=O)O)N
|
|
InChI |
InChI=1S/C20H27N3O4/c1-4-20(2,3)18-13(11-22-16(24)10-9-14(21)19(26)27)17(25)12-7-5-6-8-15(12)23-18/h4-8,13-14,18,23H,1,9-11,21H2,2-3H3,(H,22,24)(H,26,27)/t13-,14-,18-/m0/s1
|
|
InChIKey |
XWENKFHGXXDYEW-DEYYWGMASA-N
|
|
Synonyms |
Solitumine A; CHEMBL4476071
|
|
CAS | NA | |
PubChem CID | 155537754 | |
ChEMBL ID | CHEMBL4476071 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 373.4 | ALogp: | 0.0 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 122.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 27 | QED Weighted: | 0.519 |
Caco-2 Permeability: | -5.712 | MDCK Permeability: | 0.00006120 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.014 |
Human Intestinal Absorption (HIA): | 0.02 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.001 |
Blood-Brain-Barrier Penetration (BBB): | 0.772 | Plasma Protein Binding (PPB): | 68.69% |
Volume Distribution (VD): | 0.276 | Fu: | 46.65% |
CYP1A2-inhibitor: | 0.054 | CYP1A2-substrate: | 0.041 |
CYP2C19-inhibitor: | 0.094 | CYP2C19-substrate: | 0.06 |
CYP2C9-inhibitor: | 0.261 | CYP2C9-substrate: | 0.145 |
CYP2D6-inhibitor: | 0.088 | CYP2D6-substrate: | 0.252 |
CYP3A4-inhibitor: | 0.19 | CYP3A4-substrate: | 0.137 |
Clearance (CL): | 2.749 | Half-life (T1/2): | 0.668 |
hERG Blockers: | 0.032 | Human Hepatotoxicity (H-HT): | 0.045 |
Drug-inuced Liver Injury (DILI): | 0.016 | AMES Toxicity: | 0.023 |
Rat Oral Acute Toxicity: | 0.231 | Maximum Recommended Daily Dose: | 0.046 |
Skin Sensitization: | 0.156 | Carcinogencity: | 0.221 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.632 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004235 | 0.570 | D05EJG | 0.292 | ||||
ENC004237 | 0.537 | D0YA9Z | 0.278 | ||||
ENC004232 | 0.516 | D0R1CR | 0.277 | ||||
ENC004239 | 0.480 | D0Z5EM | 0.275 | ||||
ENC004234 | 0.426 | D0R1BD | 0.271 | ||||
ENC003916 | 0.341 | D0RA5Q | 0.269 | ||||
ENC004927 | 0.316 | D09CPR | 0.264 | ||||
ENC004263 | 0.304 | D0PW7C | 0.264 | ||||
ENC000140 | 0.292 | D0E9WL | 0.264 | ||||
ENC006042 | 0.288 | D02HFD | 0.263 |