|
Name |
Glulisine A
|
Molecular Formula | C11H19N3O2 | |
IUPAC Name* |
3-[5-(2-methylpropyl)-3-oxo-2,4-dihydro-1H-pyrazin-2-yl]propanamide
|
|
SMILES |
CC(C)CC1=CNC(C(=O)N1)CCC(=O)N
|
|
InChI |
InChI=1S/C11H19N3O2/c1-7(2)5-8-6-13-9(11(16)14-8)3-4-10(12)15/h6-7,9,13H,3-5H2,1-2H3,(H2,12,15)(H,14,16)
|
|
InChIKey |
VBSSYYRKWADWMM-UHFFFAOYSA-N
|
|
Synonyms |
Glulisine A
|
|
CAS | NA | |
PubChem CID | 139589551 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 225.29 | ALogp: | 0.3 |
HBD: | 3 | HBA: | 3 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 84.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 16 | QED Weighted: | 0.641 |
Caco-2 Permeability: | -4.922 | MDCK Permeability: | 0.00001980 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.024 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.001 |
Blood-Brain-Barrier Penetration (BBB): | 0.352 | Plasma Protein Binding (PPB): | 8.09% |
Volume Distribution (VD): | 0.92 | Fu: | 85.48% |
CYP1A2-inhibitor: | 0.033 | CYP1A2-substrate: | 0.06 |
CYP2C19-inhibitor: | 0.019 | CYP2C19-substrate: | 0.069 |
CYP2C9-inhibitor: | 0.003 | CYP2C9-substrate: | 0.494 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.221 |
CYP3A4-inhibitor: | 0.013 | CYP3A4-substrate: | 0.194 |
Clearance (CL): | 4.572 | Half-life (T1/2): | 0.515 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.899 |
Drug-inuced Liver Injury (DILI): | 0.081 | AMES Toxicity: | 0.966 |
Rat Oral Acute Toxicity: | 0.232 | Maximum Recommended Daily Dose: | 0.241 |
Skin Sensitization: | 0.545 | Carcinogencity: | 0.899 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.132 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002473 | 0.410 | D0R6BR | 0.250 | ||||
ENC004530 | 0.310 | D01HNL | 0.241 | ||||
ENC002257 | 0.283 | D0CT4D | 0.239 | ||||
ENC000376 | 0.277 | D05BQK | 0.232 | ||||
ENC004273 | 0.273 | D00WUF | 0.224 | ||||
ENC000990 | 0.269 | D0R1QE | 0.221 | ||||
ENC002212 | 0.269 | D01UXC | 0.218 | ||||
ENC004272 | 0.261 | D01JIA | 0.214 | ||||
ENC005482 | 0.254 | D0F0YZ | 0.214 | ||||
ENC004719 | 0.250 | D00MYT | 0.214 |