|
Name |
Strepimidazole D
|
Molecular Formula | C12H21N3O | |
IUPAC Name* |
1-(2-amino-1H-imidazol-5-yl)-7-methyloctan-1-one
|
|
SMILES |
CC(C)CCCCCC(=O)C1=CN=C(N1)N
|
|
InChI |
InChI=1S/C12H21N3O/c1-9(2)6-4-3-5-7-11(16)10-8-14-12(13)15-10/h8-9H,3-7H2,1-2H3,(H3,13,14,15)
|
|
InChIKey |
KVGKCAZQEZOQCK-UHFFFAOYSA-N
|
|
Synonyms |
Strepimidazole D
|
|
CAS | NA | |
PubChem CID | 156580782 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 223.31 | ALogp: | 3.0 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 71.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 16 | QED Weighted: | 0.548 |
Caco-2 Permeability: | -4.941 | MDCK Permeability: | 0.00001210 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.933 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.084 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.937 | Plasma Protein Binding (PPB): | 66.47% |
Volume Distribution (VD): | 0.858 | Fu: | 41.15% |
CYP1A2-inhibitor: | 0.14 | CYP1A2-substrate: | 0.858 |
CYP2C19-inhibitor: | 0.313 | CYP2C19-substrate: | 0.043 |
CYP2C9-inhibitor: | 0.251 | CYP2C9-substrate: | 0.019 |
CYP2D6-inhibitor: | 0.329 | CYP2D6-substrate: | 0.061 |
CYP3A4-inhibitor: | 0.08 | CYP3A4-substrate: | 0.245 |
Clearance (CL): | 6.884 | Half-life (T1/2): | 0.908 |
hERG Blockers: | 0.193 | Human Hepatotoxicity (H-HT): | 0.982 |
Drug-inuced Liver Injury (DILI): | 0.885 | AMES Toxicity: | 0.152 |
Rat Oral Acute Toxicity: | 0.856 | Maximum Recommended Daily Dose: | 0.862 |
Skin Sensitization: | 0.746 | Carcinogencity: | 0.924 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.195 |
Respiratory Toxicity: | 0.959 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004273 | 0.932 | D0FD0H | 0.283 | ||||
ENC004274 | 0.760 | D0G2KD | 0.277 | ||||
ENC004275 | 0.750 | D04QJD | 0.244 | ||||
ENC004270 | 0.729 | D05MFA | 0.241 | ||||
ENC004269 | 0.686 | D03LGG | 0.235 | ||||
ENC004271 | 0.667 | D0U5CE | 0.235 | ||||
ENC001274 | 0.393 | D06GWF | 0.231 | ||||
ENC000459 | 0.365 | D00DEF | 0.228 | ||||
ENC000916 | 0.358 | D09QEI | 0.225 | ||||
ENC005085 | 0.352 | D0UU9Y | 0.224 |